| id | C00037272 |
|---|---|
| Name | Hirsutanone |
| CAS RN | 41137-87-5 |
| Standard InChI | InChI=1S/C19H20O5/c20-15(8-5-14-7-10-17(22)19(24)12-14)4-2-1-3-13-6-9-16(21)18(23)11-13/h2,4,6-7,9-12,21-24H,1,3,5,8H2/b4-2+ |
| Standard InChI (Main Layer) | InChI=1S/C19H20O5/c20-15(8-5-14-7-10-17(22)19(24)12-14)4-2-1-3-13-6-9-16(21)18(23)11-13/h2,4,6-7,9-12,21-24H,1,3,5,8H2 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 1938 |
| By standard InChI | CHEMBL464274 |
|---|---|
| By standard InChI Main Layer | CHEMBL464274 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Viscaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Viscum cruciatum | 104251 | Viscaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL464274 |
CHEMBL997395
(1)
|
0 / 0 |