| id | C00037792 |
|---|---|
| Name | S-Benzyl-L-cysteine sulfoxide |
| CAS RN | 60668-81-7 |
| Standard InChI | InChI=1S/C10H13NO3S/c11-9(10(12)13)7-15(14)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-,15?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H13NO3S/c11-9(10(12)13)7-15(14)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3303 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Petiveriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Petiveria alliacea | 46142 | Petiveriaceae | eudicotyledons | Viridiplantae |