| id | C00037928 |
|---|---|
| Name | trans-Calamenene |
| CAS RN | 73209-42-4 |
| Standard InChI | InChI=1S/C15H22/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5,7,9-10,12-13H,6,8H2,1-4H3/t12-,13+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5,7,9-10,12-13H,6,8H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 824 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 2 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Cyperaceae | 2 |
| Cupressaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chamaecyparis nootkatensis | 85954 | Cupressaceae | Spermatophyta | Viridiplantae |
| Cyperus alopecuroides | 1234173 | Cyperaceae | Liliopsida | Viridiplantae |
| Cyperus rotundus | 512623 | Cyperaceae | Liliopsida | Viridiplantae |