id | C00038192 |
---|---|
Name | 1-Hydroxyxanthone |
CAS RN | 719-41-5 |
Standard InChI | InChI=1S/C13H8O3/c14-9-5-3-7-11-12(9)13(15)8-4-1-2-6-10(8)16-11/h1-7,14H |
Standard InChI (Main Layer) | InChI=1S/C13H8O3/c14-9-5-3-7-11-12(9)13(15)8-4-1-2-6-10(8)16-11/h1-7,14H |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 76 |
By standard InChI | CHEMBL187368 |
---|---|
By standard InChI Main Layer | CHEMBL187368 |
By LinkDB |
---|
By CAS RN | C478872 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Hypericaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Hypericum geminiflorum | 860794 | Hypericaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL187368 |
CHEMBL827909
(1)
|
1 / 1 |