| id | C00038192 |
|---|---|
| Name | 1-Hydroxyxanthone |
| CAS RN | 719-41-5 |
| Standard InChI | InChI=1S/C13H8O3/c14-9-5-3-7-11-12(9)13(15)8-4-1-2-6-10(8)16-11/h1-7,14H |
| Standard InChI (Main Layer) | InChI=1S/C13H8O3/c14-9-5-3-7-11-12(9)13(15)8-4-1-2-6-10(8)16-11/h1-7,14H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 76 |
| By standard InChI | CHEMBL187368 |
|---|---|
| By standard InChI Main Layer | CHEMBL187368 |
| By LinkDB |
|---|
| By CAS RN | C478872 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Hypericaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hypericum geminiflorum | 860794 | Hypericaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL187368 |
CHEMBL827909
(1)
|
1 / 1 |