id | C00038258 |
---|---|
Name | 3-Methylcarbazole |
CAS RN | 4630-20-0 |
Standard InChI | InChI=1S/C13H11N/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-8,14H,1H3 |
Standard InChI (Main Layer) | InChI=1S/C13H11N/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-8,14H,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 751 |
By standard InChI | CHEMBL1173768 |
---|---|
By standard InChI Main Layer | CHEMBL1173768 |
By LinkDB |
---|
By CAS RN | C110004 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Clausena excavata | 76959 | Rutaceae | rosids | Viridiplantae |
Glycosmis arborea | 68543 | Rutaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P52732 | Kinesin-like protein KIF11 | Other cytosolic protein | CHEMBL1173768 |
CHEMBL1177081
(1)
|
1 / 0 |
OMIM | preferred title | UniProt |
---|---|---|
#152950 | Microcephaly with or without chorioretinopathy, lymphedema, or mental retardation; mclmr |
P52732
|