| id | C00000393 |
|---|---|
| Name | 9-HPOD / 9-Hydroperoxyoctadecadienoic acid |
| CAS RN | 28040-11-1 |
| Standard InChI | InChI=1S/C18H32O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h6,8,11,14,17,21H,2-5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/b8-6-,14-11+ |
| Standard InChI (Main Layer) | InChI=1S/C18H32O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h6,8,11,14,17,21H,2-5,7,9-10,12-13,15-16H2,1H3,(H,19,20) |
| Phytochemical cluster | No. 68 |
|---|---|
| KCF-S cluster | No. 367 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1594141 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Viridiplantae | 1 |
| family name | count |
|---|---|
| Chlorellaceae | 1 |
| Nectriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chlorella pyrenoidosa | 3078 | Chlorellaceae | Viridiplantae | Viridiplantae |
| Fusarium oxysporum | 5507 | Nectriaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P49798 | Regulator of G-protein signaling 4 | Unclassified protein | CHEMBL1594141 |
CHEMBL1794499
(1)
|
2 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1594141 |
CHEMBL1614211
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #604906 | Schizophrenia 9; sczd9 |
P49798
|
| #181500 | Schizophrenia; sczd |
P49798
|