| id | C00039755 |
|---|---|
| Name | Methyl carbazole-3-carboxylate |
| CAS RN | 97931-41-4 |
| Standard InChI | InChI=1S/C14H11NO2/c1-17-14(16)9-6-7-13-11(8-9)10-4-2-3-5-12(10)15-13/h2-8,15H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C14H11NO2/c1-17-14(16)9-6-7-13-11(8-9)10-4-2-3-5-12(10)15-13/h2-8,15H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 807 |
| By standard InChI | CHEMBL446253 |
|---|---|
| By standard InChI Main Layer | CHEMBL446253 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Clausena excavata | 76959 | Rutaceae | rosids | Viridiplantae |
| Glycosmis arborea | 68543 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P52732 | Kinesin-like protein KIF11 | Other cytosolic protein | CHEMBL446253 |
CHEMBL1177081
(1)
|
1 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #152950 | Microcephaly with or without chorioretinopathy, lymphedema, or mental retardation; mclmr |
P52732
|