| id | C00004047 | 
|---|---|
| Name | Isopongaflavone / Candidin (Tephrosia) / 5-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one | 
| CAS RN | 64125-33-3 | 
| Standard InChI | InChI=1S/C21H18O4/c1-21(2)10-9-14-17(25-21)12-18(23-3)19-15(22)11-16(24-20(14)19)13-7-5-4-6-8-13/h4-12H,1-3H3 | 
| Standard InChI (Main Layer) | InChI=1S/C21H18O4/c1-21(2)10-9-14-17(25-21)12-18(23-3)19-15(22)11-16(24-20(14)19)13-7-5-4-6-8-13/h4-12H,1-3H3 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 24 | 
| By standard InChI | CHEMBL454843 | 
|---|---|
| By standard InChI Main Layer | CHEMBL454843 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Dahlstedtia pinnata | 62116 | Fabaceae | rosids | Viridiplantae | 
| Lonchocarpus costaricensis | 1127057 | Fabaceae | rosids | Viridiplantae | 
| Millettia pinnata | 56065 | Fabaceae | rosids | Viridiplantae | 
| Tephrosia bracteolata | 3803 | Fabaceae | rosids | Viridiplantae | 
| Tephrosia tunicata | 3803 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL454843 | CHEMBL1738312
                        (1) | 0 / 0 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL454843 | CHEMBL1614458
                        (1) | 0 / 0 | 
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL454843 | CHEMBL1794486
                        (1) | 0 / 0 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL454843 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL454843 | CHEMBL2114843
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL454843 | CHEMBL2114788
                        (1)
                        CHEMBL2114931
                        (1) | 0 / 0 | 
| Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 | Unclassified protein | CHEMBL454843 | CHEMBL1614280
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL454843 | CHEMBL1738184
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL454843 | CHEMBL1964082
                        (1)
                        CHEMBL1963857
                        (1) CHEMBL1964002 (1) | 1 / 0 | 
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL454843 | CHEMBL2354287
                        (1) | 1 / 1 |