| id | C00004090 |
|---|---|
| Name | Licoflavone C / 8-Prenylapigenin / 5,7,4'-Trihydroxy-8-prenylflavone / 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| CAS RN | 72357-31-4 |
| Standard InChI | InChI=1S/C20H18O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H18O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 15 |
| By standard InChI | CHEMBL371562 |
|---|---|
| By standard InChI Main Layer | CHEMBL371562 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL371562 |
CHEMBL998833
(1)
|
0 / 0 |