| id | C00041994 |
|---|---|
| Name | (+)-Diaeudesmin |
| CAS RN | 16499-02-8 |
| Standard InChI | InChI=1S/C22H26O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-28-22(16(15)12-27-21)14-6-8-18(24-2)20(10-14)26-4/h5-10,15-16,21-22H,11-12H2,1-4H3/t15-,16-,21-,22-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H26O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-28-22(16(15)12-27-21)14-6-8-18(24-2)20(10-14)26-4/h5-10,15-16,21-22H,11-12H2,1-4H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 38 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL519099 CHEMBL512865 CHEMBL523743 CHEMBL464352 CHEMBL1726879 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Piperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Piper peepuloides | 13215 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1726879 |
CHEMBL1738606
(1)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1726879 |
CHEMBL1794536
(1)
|
0 / 0 |