| id | C00041994 | 
|---|---|
| Name | (+)-Diaeudesmin | 
| CAS RN | 16499-02-8 | 
| Standard InChI | InChI=1S/C22H26O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-28-22(16(15)12-27-21)14-6-8-18(24-2)20(10-14)26-4/h5-10,15-16,21-22H,11-12H2,1-4H3/t15-,16-,21-,22-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C22H26O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-28-22(16(15)12-27-21)14-6-8-18(24-2)20(10-14)26-4/h5-10,15-16,21-22H,11-12H2,1-4H3 | 
| Phytochemical cluster | No. 21 | 
|---|---|
| KCF-S cluster | No. 38 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL519099 CHEMBL512865 CHEMBL523743 CHEMBL464352 CHEMBL1726879 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Magnoliophyta | 1 | 
| family name | count | 
|---|---|
| Piperaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Piper peepuloides | 13215 | Piperaceae | Magnoliophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1726879 | CHEMBL1738606
                        (1) | 0 / 0 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1726879 | CHEMBL1794536
                        (1) | 0 / 0 |