| id | C00042067 | 
|---|---|
| Name | 2,5-Dideoxy-2,5-imino-D-glucitol / (+)-2,5-Dideoxy-2,5-imino-D-glucitol | 
| CAS RN | 132295-44-4 | 
| Standard InChI | InChI=1S/C6H13NO4/c8-1-3-5(10)6(11)4(2-9)7-3/h3-11H,1-2H2/t3-,4+,5-,6-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C6H13NO4/c8-1-3-5(10)6(11)4(2-9)7-3/h3-11H,1-2H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 667 | 
| By standard InChI | CHEMBL259905 | 
|---|---|
| By standard InChI Main Layer | CHEMBL10437 CHEMBL312653 CHEMBL121093 CHEMBL259905 CHEMBL405957 CHEMBL469844 CHEMBL2008021 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Stemonaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Stemona tuberosa | 167572 | Stemonaceae | Liliopsida | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P04062 | Glucosylceramidase | Enzyme | CHEMBL10437 | CHEMBL650036
                        (1)
                        CHEMBL650038
                        (1) | 6 / 4 | 
| Q14697 | Neutral alpha-glucosidase AB | Enzyme | CHEMBL121093 | CHEMBL641728
                        (1)
                        CHEMBL645811
                        (1) CHEMBL645965 (1) CHEMBL645968 (1) CHEMBL646086 (1) | 0 / 0 | 
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL259905 | CHEMBL1007693
                        (1) | 1 / 1 | 
| Q9H227 | Cytosolic beta-glucosidase | Enzyme | CHEMBL259905 | CHEMBL1007694
                        (1) | 0 / 0 | 
| P35573 | Glycogen debranching enzyme | Enzyme | CHEMBL312653 CHEMBL259905 CHEMBL405957 | CHEMBL923883
                        (3) | 1 / 1 | 
| P04066 | Tissue alpha-L-fucosidase | Enzyme | CHEMBL121093 | CHEMBL649571
                        (1)
                        CHEMBL649586
                        (1) | 1 / 2 | 
| P06280 | Alpha-galactosidase A | Enzyme | CHEMBL469844 | CHEMBL1168041
                        (1)
                        CHEMBL1168060
                        (1) CHEMBL1168063 (1) CHEMBL1168064 (1) CHEMBL1168065 (1) CHEMBL1168066 (1) | 1 / 1 | 
| O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL312653 | CHEMBL710107
                        (1) | 0 / 0 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #301500 | Fabry disease | P06280 | 
| #230000 | Fucosidosis | P04066 | 
| #608013 | Gaucher disease, perinatal lethal | P04062 | 
| #230800 | Gaucher disease, type i | P04062 | 
| #230900 | Gaucher disease, type ii | P04062 | 
| #231000 | Gaucher disease, type iii | P04062 | 
| #231005 | Gaucher disease, type iiic | P04062 | 
| #232300 | Glycogen storage disease ii | P10253 | 
| #232400 | Glycogen storage disease iii | P35573 | 
| #168600 | Parkinson disease, late-onset; pd | P04062 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00066 | Lewy body dementia (LBD) | P04062
                            (related) | 
| H00126 | Gaucher disease | P04062
                            (related) | 
| H00426 | Defects in the degradation of ganglioside | P04062
                            (related) | 
| H00810 | Progressive myoclonic epilepsy (PME) | P04062
                            (related) | 
| H00141 | Fucosidosis | P04066
                            (related) | 
| H00422 | Glycoproteinoses | P04066
                            (related) | 
| H00125 | Fabry disease | P06280
                            (related) | 
| H00069 | Glycogen storage diseases (GSD) | P10253
                            (related) P35573 (related) |