id | C00042103 |
---|---|
Name | 3,4-Dihydroxyxanthone |
CAS RN | 39731-48-1 |
Standard InChI | InChI=1S/C13H8O4/c14-9-6-5-8-11(15)7-3-1-2-4-10(7)17-13(8)12(9)16/h1-6,14,16H |
Standard InChI (Main Layer) | InChI=1S/C13H8O4/c14-9-6-5-8-11(15)7-3-1-2-4-10(7)17-13(8)12(9)16/h1-6,14,16H |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 76 |
By standard InChI | CHEMBL446323 |
---|---|
By standard InChI Main Layer | CHEMBL446323 |
By LinkDB |
---|
By CAS RN | C074257 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Calophyllaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Calophyllum membranaceum | 1009336 | Calophyllaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL446323 |
CHEMBL998270
(1)
|
0 / 3 |
P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL446323 |
CHEMBL998269
(1)
|
0 / 0 |