| id | C00042103 |
|---|---|
| Name | 3,4-Dihydroxyxanthone |
| CAS RN | 39731-48-1 |
| Standard InChI | InChI=1S/C13H8O4/c14-9-6-5-8-11(15)7-3-1-2-4-10(7)17-13(8)12(9)16/h1-6,14,16H |
| Standard InChI (Main Layer) | InChI=1S/C13H8O4/c14-9-6-5-8-11(15)7-3-1-2-4-10(7)17-13(8)12(9)16/h1-6,14,16H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 76 |
| By standard InChI | CHEMBL446323 |
|---|---|
| By standard InChI Main Layer | CHEMBL446323 |
| By LinkDB |
|---|
| By CAS RN | C074257 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Calophyllaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Calophyllum membranaceum | 1009336 | Calophyllaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL446323 |
CHEMBL998270
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL446323 |
CHEMBL998269
(1)
|
0 / 0 |