| id | C00000423 |
|---|---|
| Name | 5-HETE / 5-Hydroxyarachidonic acid |
| CAS RN | |
| Standard InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h6-7,9-10,12-14,16,19,21H,2-5,8,11,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,13-12-,16-14+ |
| Standard InChI (Main Layer) | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h6-7,9-10,12-14,16,19,21H,2-5,8,11,15,17-18H2,1H3,(H,22,23) |
| Phytochemical cluster | No. 68 |
|---|---|
| KCF-S cluster | No. 300 |
| By standard InChI | CHEMBL17695 |
|---|---|
| By standard InChI Main Layer | CHEMBL17695 CHEMBL164813 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Corallinaceae | 1 |
| Poaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lithothamnion corallioides | 48598 | Corallinaceae | Eukaryota | |
| Zea mays | 4577 | Poaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O14880 | Microsomal glutathione S-transferase 3 | Enzyme | CHEMBL164813 |
CHEMBL1743241
(1)
|
0 / 0 |
| P09917 | Arachidonate 5-lipoxygenase | Oxidoreductase | CHEMBL164813 |
CHEMBL618100
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL164813 |
CHEMBL1614421
(1)
|
4 / 3 |