| id | C00044152 |
|---|---|
| Name | dl-Syringaresinol |
| CAS RN | 117714-6 |
| Standard InChI | InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 38 |
| By standard InChI | CHEMBL361362 |
|---|---|
| By standard InChI Main Layer | CHEMBL361362 CHEMBL402653 |
| By LinkDB | C10889 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Toddalia asiatica | 159068 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL361362 |
CHEMBL832445
(1)
CHEMBL832449
(1)
CHEMBL832452 (1) |
0 / 0 |