id | C00044191 |
---|---|
Name | Guvacoline |
CAS RN | 495-19-2 |
Standard InChI | InChI=1S/C7H11NO2/c1-10-7(9)6-3-2-4-8-5-6/h3,8H,2,4-5H2,1H3 |
Standard InChI (Main Layer) | InChI=1S/C7H11NO2/c1-10-7(9)6-3-2-4-8-5-6/h3,8H,2,4-5H2,1H3 |
Phytochemical cluster | No. 1 |
---|---|
KCF-S cluster | No. 3405 |
By standard InChI | CHEMBL268808 |
---|---|
By standard InChI Main Layer | CHEMBL268808 |
By LinkDB | C16821 |
---|
By CAS RN | C094105 |
---|
class name | count |
---|---|
Liliopsida | 1 |
family name | count |
---|---|
Arecaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Areca catechu | 184783 | Arecaceae | Liliopsida | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL268808 |
CHEMBL749054
(1)
|
1 / 0 |
OMIM | preferred title | UniProt |
---|---|---|
#100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|