| id | C00044191 |
|---|---|
| Name | Guvacoline |
| CAS RN | 495-19-2 |
| Standard InChI | InChI=1S/C7H11NO2/c1-10-7(9)6-3-2-4-8-5-6/h3,8H,2,4-5H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C7H11NO2/c1-10-7(9)6-3-2-4-8-5-6/h3,8H,2,4-5H2,1H3 |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 3405 |
| By standard InChI | CHEMBL268808 |
|---|---|
| By standard InChI Main Layer | CHEMBL268808 |
| By LinkDB | C16821 |
|---|
| By CAS RN | C094105 |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Arecaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Areca catechu | 184783 | Arecaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL268808 |
CHEMBL749054
(1)
|
1 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|