| id | C00046045 |
|---|---|
| Name | Isocrenatoside |
| CAS RN | 221895-09-6 |
| Standard InChI | InChI=1S/C29H34O15/c1-12-22(35)24(37)25(38)28(41-12)44-26-23(36)20(11-39-21(34)7-3-13-2-5-15(30)17(32)8-13)43-29-27(26)42-19(10-40-29)14-4-6-16(31)18(33)9-14/h2-9,12,19-20,22-33,35-38H,10-11H2,1H3/b7-3+/t12-,19+,20+,22-,23+,24+,25+,26-,27+,28-,29+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C29H34O15/c1-12-22(35)24(37)25(38)28(41-12)44-26-23(36)20(11-39-21(34)7-3-13-2-5-15(30)17(32)8-13)43-29-27(26)42-19(10-40-29)14-4-6-16(31)18(33)9-14/h2-9,12,19-20,22-33,35-38H,10-11H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 33 |
| By standard InChI | CHEMBL402471 |
|---|---|
| By standard InChI Main Layer | CHEMBL402471 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Plantaginaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Globularia trichosantha | 285841 | Plantaginaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P12821 | Angiotensin-converting enzyme | M2 | CHEMBL402471 |
CHEMBL999963
(1)
CHEMBL999964
(1)
CHEMBL999967 (1) |
4 / 2 |