| id | C00004633 |
|---|---|
| Name | Azaleatin |
| CAS RN | 529-51-1 |
| Standard InChI | InChI=1S/C16H12O7/c1-22-11-5-8(17)6-12-13(11)14(20)15(21)16(23-12)7-2-3-9(18)10(19)4-7/h2-6,17-19,21H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H12O7/c1-22-11-5-8(17)6-12-13(11)14(20)15(21)16(23-12)7-2-3-9(18)10(19)4-7/h2-6,17-19,21H,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL470848 |
|---|---|
| By standard InChI Main Layer | CHEMBL470848 |
| By LinkDB | C10022 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 6 |
| asterids | 3 |
| eudicotyledons | 2 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 4 |
| Ericaceae | 3 |
| Cunoniaceae | 1 |
| Lauraceae | 1 |
| Dilleniaceae | 1 |
| Juglandaceae | 1 |
| Plumbaginaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9NPH5 | NADPH oxidase 4 | Enzyme | CHEMBL470848 |
CHEMBL1249157
(1)
CHEMBL1249158
(1)
CHEMBL1249160 (1) |
0 / 0 |
| P04792 | Heat shock protein beta-1 | Unclassified protein | CHEMBL470848 |
CHEMBL993710
(1)
|
2 / 1 |