| id | C00047902 |
|---|---|
| Name | Ginkgotoxin |
| CAS RN | 1464-33-1 |
| Standard InChI | InChI=1S/C9H13NO3/c1-6-9(12)8(5-13-2)7(4-11)3-10-6/h3,11-12H,4-5H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C9H13NO3/c1-6-9(12)8(5-13-2)7(4-11)3-10-6/h3,11-12H,4-5H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2457 |
| By standard InChI | CHEMBL1076875 |
|---|---|
| By standard InChI Main Layer | CHEMBL1076875 |
| By LinkDB |
|---|
| By CAS RN | C001737 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 1 |
| Ginkgoaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Albizzia tanganyicensis | 3812 | Fabaceae | rosids | Viridiplantae |
| Ginkgo biloba | 3311 | Ginkgoaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O00764 | Pyridoxal kinase | Enzyme | CHEMBL1076875 |
CHEMBL1116771
(1)
|
0 / 0 |
| Q05329 | Glutamate decarboxylase 2 | Enzyme | CHEMBL1076875 |
CHEMBL1116773
(1)
|
0 / 0 |
| Q99259 | Glutamate decarboxylase 1 | Enzyme | CHEMBL1076875 |
CHEMBL1116774
(1)
|
1 / 1 |