id | C00048436 |
---|---|
Name | Isoindigo |
CAS RN | 476-34-6 |
Standard InChI | InChI=1S/C16H10N2O2/c19-15-13(9-5-1-3-7-11(9)17-15)14-10-6-2-4-8-12(10)18-16(14)20/h1-8H,(H,17,19)(H,18,20)/b14-13+ |
Standard InChI (Main Layer) | InChI=1S/C16H10N2O2/c19-15-13(9-5-1-3-7-11(9)17-15)14-10-6-2-4-8-12(10)18-16(14)20/h1-8H,(H,17,19)(H,18,20) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 4840 |
By standard InChI | CHEMBL515155 |
---|---|
By standard InChI Main Layer | CHEMBL515155 |
By LinkDB |
---|
By CAS RN | C049010 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Brassicaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Isatis tinctoria | 161756 | Brassicaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P21980 | Protein-glutamine gamma-glutamyltransferase 2 | Enzyme | CHEMBL515155 |
CHEMBL1771981
(2)
|
0 / 0 |
P20248 | Cyclin-A2 | Other cytosolic protein | CHEMBL515155 |
CHEMBL1066113
(1)
|
0 / 0 |
P78396 | Cyclin-A1 | Other cytosolic protein | CHEMBL515155 |
CHEMBL1066113
(1)
|
0 / 0 |
P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL515155 |
CHEMBL1066113
(1)
|
0 / 0 |