| id | C00049586 |
|---|---|
| Name | Angoroside A |
| CAS RN | 111316-35-9 |
| Standard InChI | InChI=1S/C34H44O19/c1-14-24(41)26(43)28(45)34(50-14)53-31-29(46)33(47-9-8-16-3-6-18(36)20(38)11-16)51-22(13-49-32-27(44)25(42)21(39)12-48-32)30(31)52-23(40)7-4-15-2-5-17(35)19(37)10-15/h2-7,10-11,14,21-22,24-39,41-46H,8-9,12-13H2,1H3/b7-4+/t14-,21-,22+,24-,25-,26+,27+,28+,29+,30+,31+,32-,33+,34-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C34H44O19/c1-14-24(41)26(43)28(45)34(50-14)53-31-29(46)33(47-9-8-16-3-6-18(36)20(38)11-16)51-22(13-49-32-27(44)25(42)21(39)12-48-32)30(31)52-23(40)7-4-15-2-5-17(35)19(37)10-15/h2-7,10-11,14,21-22,24-39,41-46H,8-9,12-13H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 33 |
| By standard InChI | CHEMBL506436 |
|---|---|
| By standard InChI Main Layer | CHEMBL506436 CHEMBL455827 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Scrophulariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Scrophularia nodosa L. | 90363 | Scrophulariaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL455827 |
CHEMBL1008495
(1)
|
0 / 3 |