| id | C00049958 |
|---|---|
| Name | 5'-Desgalloylstachyurin |
| CAS RN | 115406-24-1 |
| Standard InChI | InChI=1S/C34H24O22/c35-8-1-5-12(21(42)18(8)39)13-6(2-9(36)19(40)22(13)43)32(50)54-28(11(38)4-53-31(5)49)30-29-26(47)17-16(34(52)55-29)15(24(45)27(48)25(17)46)14-7(33(51)56-30)3-10(37)20(41)23(14)44/h1-3,11,26,28-30,35-48H,4H2 |
| Standard InChI (Main Layer) | InChI=1S/C34H24O22/c35-8-1-5-12(21(42)18(8)39)13-6(2-9(36)19(40)22(13)43)32(50)54-28(11(38)4-53-31(5)49)30-29-26(47)17-16(34(52)55-29)15(24(45)27(48)25(17)46)14-7(33(51)56-30)3-10(37)20(41)23(14)44/h1-3,11,26,28-30,35-48H,4H2 |
| Phytochemical cluster | No. 81 |
|---|---|
| KCF-S cluster | No. 226 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL509562 CHEMBL488110 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Geum japonicum | 321607 | Rosaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00742 | Coagulation factor X | S1A | CHEMBL509562 CHEMBL488110 |
CHEMBL1007649
(2)
CHEMBL1007650
(2)
|
1 / 0 |