| id | C00050033 | 
|---|---|
| Name | Casuariin | 
| CAS RN | 79786-04-2 | 
| Standard InChI | InChI=1S/C34H24O22/c35-8-1-5-12(21(42)18(8)39)13-6(2-9(36)19(40)22(13)43)32(50)54-28(11(38)4-53-31(5)49)30-29-26(47)17-16(34(52)55-29)15(24(45)27(48)25(17)46)14-7(33(51)56-30)3-10(37)20(41)23(14)44/h1-3,11,26,28-30,35-48H,4H2 | 
| Standard InChI (Main Layer) | InChI=1S/C34H24O22/c35-8-1-5-12(21(42)18(8)39)13-6(2-9(36)19(40)22(13)43)32(50)54-28(11(38)4-53-31(5)49)30-29-26(47)17-16(34(52)55-29)15(24(45)27(48)25(17)46)14-7(33(51)56-30)3-10(37)20(41)23(14)44/h1-3,11,26,28-30,35-48H,4H2 | 
| Phytochemical cluster | No. 81 | 
|---|---|
| KCF-S cluster | No. 226 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL509562 CHEMBL488110 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Geum japonicum | 321607 | Rosaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P00742 | Coagulation factor X | S1A | CHEMBL509562 CHEMBL488110 | CHEMBL1007649
                        (2)
                        CHEMBL1007650
                        (2) | 1 / 0 |