| id | C00005178 |
|---|---|
| Name | Kaempferol 3-galactoside-7-rhamnoside |
| CAS RN | 38784-79-1 |
| Standard InChI | InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(38-9)39-12-6-13(30)16-14(7-12)40-24(10-2-4-11(29)5-3-10)25(19(16)33)42-27-23(37)21(35)18(32)15(8-28)41-27/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9?,15?,17-,18-,20-,21?,22?,23?,26-,27-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(38-9)39-12-6-13(30)16-14(7-12)40-24(10-2-4-11(29)5-3-10)25(19(16)33)42-27-23(37)21(35)18(32)15(8-28)41-27/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1929192 CHEMBL1929193 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Fabaceae | 3 |
| Brassicaceae | 1 |
| Ericaceae | 1 |
| Solanaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Cladothamnus pyrolaeflorus | 4345 | Ericaceae | asterids | Viridiplantae |
| Robinia neomexicana | 168546 | Fabaceae | rosids | Viridiplantae |
| Robinia pseudoacacia | 35938 | Fabaceae | rosids | Viridiplantae |
| Solanum spp. | 4107 | Solanaceae | asterids | Viridiplantae |
| Vicia faba | 3906 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL1929192 CHEMBL1929193 |
CHEMBL1932251
(2)
CHEMBL1932252
(1)
CHEMBL1932253 (2) |
0 / 0 |
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL1929192 CHEMBL1929193 |
CHEMBL1932254
(2)
CHEMBL1932258
(1)
CHEMBL1932265 (1) |
0 / 0 |