| id | C00005850 |
|---|---|
| Name | Kaempferol 3-(3''-p-coumarylglucoside) |
| CAS RN | 74712-68-8 |
| Standard InChI | InChI=1S/C30H26O13/c31-13-21-24(37)28(42-22(36)10-3-14-1-6-16(32)7-2-14)26(39)30(41-21)43-29-25(38)23-19(35)11-18(34)12-20(23)40-27(29)15-4-8-17(33)9-5-15/h1-12,21,24,26,28,30-35,37,39H,13H2/b10-3+/t21?,24-,26-,28?,30+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H26O13/c31-13-21-24(37)28(42-22(36)10-3-14-1-6-16(32)7-2-14)26(39)30(41-21)43-29-25(38)23-19(35)11-18(34)12-20(23)40-27(29)15-4-8-17(33)9-5-15/h1-12,21,24,26,28,30-35,37,39H,13H2 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 30 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL448883 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 2 |
| family name | count |
|---|---|
| Pinaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Larix leptolepis | 54800 | Pinaceae | Spermatophyta | Viridiplantae |
| Picea obovata | 331118 | Pinaceae | Spermatophyta | Viridiplantae |