| id | C00000607 |
|---|---|
| Name | (+)-Matairesinol |
| CAS RN | 148409-36-3 |
| Standard InChI | InChI=1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 223 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL425148 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Embryophyta | 1 |
| family name | count |
|---|---|
| Selaginellaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Selaginella doederleinii | 186426 | Selaginellaceae | Embryophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04278 | Sex hormone-binding globulin | Secreted protein | CHEMBL425148 |
CHEMBL922711
(1)
CHEMBL1025921
(1)
|
0 / 0 |