| id | C00000648 |
|---|---|
| Name | (+)-Phillyrin |
| CAS RN | 487-41-2 |
| Standard InChI | InChI=1S/C27H34O11/c1-32-17-6-4-13(8-19(17)33-2)25-15-11-36-26(16(15)12-35-25)14-5-7-18(20(9-14)34-3)37-27-24(31)23(30)22(29)21(10-28)38-27/h4-9,15-16,21-31H,10-12H2,1-3H3/t15-,16-,21?,22+,23-,24?,25-,26+,27+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H34O11/c1-32-17-6-4-13(8-19(17)33-2)25-15-11-36-26(16(15)12-35-25)14-5-7-18(20(9-14)34-3)37-27-24(31)23(30)22(29)21(10-28)38-27/h4-9,15-16,21-31H,10-12H2,1-3H3 |
| Phytochemical cluster | No. 22 |
|---|---|
| KCF-S cluster | No. 174 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL462767 |
| By LinkDB | C17048 |
|---|
| By CAS RN | C075528 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Forsythia viridissima | 205691 | Oleaceae | asterids | Viridiplantae |
| Osmanthus heterophyllus | 126555 | Oleaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL462767 |
CHEMBL1008496
(1)
|
0 / 0 |