| id | C00006484 |
|---|---|
| Name | Sumaflavone |
| CAS RN | 114312-08-2 |
| Standard InChI | InChI=1S/C30H18O11/c31-14-4-1-12(2-5-14)21-11-20(36)26-28(38)29(39)27(37)24(30(26)41-21)16-7-13(3-6-17(16)33)22-10-19(35)25-18(34)8-15(32)9-23(25)40-22/h1-11,31-34,37-39H |
| Standard InChI (Main Layer) | InChI=1S/C30H18O11/c31-14-4-1-12(2-5-14)21-11-20(36)26-28(38)29(39)27(37)24(30(26)41-21)16-7-13(3-6-17(16)33)22-10-19(35)25-18(34)8-15(32)9-23(25)40-22/h1-11,31-34,37-39H |
| Phytochemical cluster | No. 18 |
|---|---|
| KCF-S cluster | No. 34 |
| By standard InChI | CHEMBL270509 |
|---|---|
| By standard InChI Main Layer | CHEMBL270509 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Anacardiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Rhus coriaria | 298661 | Anacardiaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08253 | 72 kDa type IV collagenase | M10A | CHEMBL270509 |
CHEMBL945961
(1)
|
1 / 3 |