| id | C00006495 |
|---|---|
| Name | Amentoflavone 7'',4'''-dimethyl ether |
| CAS RN | 34293-14-6 |
| Standard InChI | InChI=1S/C32H22O10/c1-39-18-6-3-15(4-7-18)25-13-23(37)31-24(38)14-27(40-2)29(32(31)42-25)19-9-16(5-8-20(19)34)26-12-22(36)30-21(35)10-17(33)11-28(30)41-26/h3-14,33-35,38H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C32H22O10/c1-39-18-6-3-15(4-7-18)25-13-23(37)31-24(38)14-27(40-2)29(32(31)42-25)19-9-16(5-8-20(19)34)26-12-22(36)30-21(35)10-17(33)11-28(30)41-26/h3-14,33-35,38H,1-2H3 |
| Phytochemical cluster | No. 18 |
|---|---|
| KCF-S cluster | No. 34 |
| By standard InChI | CHEMBL374055 |
|---|---|
| By standard InChI Main Layer | CHEMBL374055 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 5 |
| family name | count |
|---|---|
| Podocarpaceae | 3 |
| Cupressaceae | 2 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P43235 | Cathepsin K | C1A | CHEMBL374055 |
CHEMBL913665
(1)
|
1 / 2 |
| P56817 | Beta-secretase 1 | A1A | CHEMBL374055 |
CHEMBL1211753
(1)
|
0 / 0 |