| id | C00006940 |
|---|---|
| Name | 2,4,2',4'-Tetrahydroxychalcone |
| CAS RN | 123702-96-5 |
| Standard InChI | InChI=1S/C15H12O5/c16-10-3-1-9(14(19)7-10)2-6-13(18)12-5-4-11(17)8-15(12)20/h1-8,16-17,19-20H/b6-2+ |
| Standard InChI (Main Layer) | InChI=1S/C15H12O5/c16-10-3-1-9(14(19)7-10)2-6-13(18)12-5-4-11(17)8-15(12)20/h1-8,16-17,19-20H |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 92 |
| By standard InChI | CHEMBL394855 |
|---|---|
| By standard InChI Main Layer | CHEMBL394855 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae |
| Morus alba | 3498 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL394855 |
CHEMBL949646
(1)
|
2 / 2 |