| id | C00006973 |
|---|---|
| Name | 3,4,2',4',6'-Pentahydroxychalcone |
| CAS RN | 14917-41-0 / 73692-51-0 |
| Standard InChI | InChI=1S/C15H12O6/c16-9-6-13(20)15(14(21)7-9)11(18)4-2-8-1-3-10(17)12(19)5-8/h1-7,16-17,19-21H/b4-2+ |
| Standard InChI (Main Layer) | InChI=1S/C15H12O6/c16-9-6-13(20)15(14(21)7-9)11(18)4-2-8-1-3-10(17)12(19)5-8/h1-7,16-17,19-21H |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 92 |
| By standard InChI | CHEMBL127409 |
|---|---|
| By standard InChI Main Layer | CHEMBL127409 |
| By LinkDB | C15525 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| rosids | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Plumbaginaceae | 1 |
| Salicaceae | 1 |
| Liliaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Limonium sp. | 46093 | Plumbaginaceae | eudicotyledons | Viridiplantae |
| Populus sieboldii | 3689 | Salicaceae | rosids | Viridiplantae |
| Tulipa sp. | 45423 | Liliaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL127409 |
CHEMBL874014
(1)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL127409 |
CHEMBL874014
(1)
|
0 / 3 |