| id | C00007064 | 
|---|---|
| Name | 4-Hydroxyderricin | 
| CAS RN | 55912-03-3 | 
| Standard InChI | InChI=1S/C21H22O4/c1-14(2)4-10-18-20(25-3)13-11-17(21(18)24)19(23)12-7-15-5-8-16(22)9-6-15/h4-9,11-13,22,24H,10H2,1-3H3/b12-7+ | 
| Standard InChI (Main Layer) | InChI=1S/C21H22O4/c1-14(2)4-10-18-20(25-3)13-11-17(21(18)24)19(23)12-7-15-5-8-16(22)9-6-15/h4-9,11-13,22,24H,10H2,1-3H3 | 
| Phytochemical cluster | No. 13 | 
|---|---|
| KCF-S cluster | No. 133 | 
| By standard InChI | CHEMBL458094 | 
|---|---|
| By standard InChI Main Layer | CHEMBL458094 | 
| By LinkDB | 
|---|
| By CAS RN | C068243 | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Angelica keiskei | 357850 | Apiaceae | asterids | Viridiplantae | 
| Lonchocarpus neuroscapha | 3925 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL458094 | CHEMBL1738312
                        (1) | 0 / 0 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL458094 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL458094 | CHEMBL1614544
                        (1) | 11 / 10 | 
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL458094 | CHEMBL2354282
                        (1) | 4 / 2 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL458094 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL458094 | CHEMBL2114843
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL458094 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL458094 | CHEMBL1794401
                        (1) | 0 / 0 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL458094 | CHEMBL1794483
                        (1) | 0 / 0 | 
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL458094 | CHEMBL1737991
                        (1) | 0 / 0 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL458094 | CHEMBL1614250
                        (1)
                        CHEMBL1614421
                        (1) CHEMBL1614502 (1) | 4 / 3 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL458094 | CHEMBL1738442
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL458094 | CHEMBL2354311
                        (1) | 1 / 0 | 
| O00255 | Menin | Unclassified protein | CHEMBL458094 | CHEMBL1614257
                        (1) | 2 / 5 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL458094 | CHEMBL1614257
                        (1) | 1 / 3 | 
| P01215 | Glycoprotein hormones alpha chain | Unclassified protein | CHEMBL458094 | CHEMBL2114913
                        (1) | 0 / 3 | 
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL458094 | CHEMBL2354287
                        (1) | 1 / 1 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 | Q13148 | 
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a | P02545 | 
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism | P02545 | 
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 | P02545 | 
| #114500 | Colorectal cancer; crc | P84022 | 
| #127750 | Dementia, lewy body; dlb | P37840 | 
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 | P02545 | 
| #600274 | Frontotemporal dementia; ftd | P10636 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #610140 | Heart-hand syndrome, slovenian type | P02545 | 
| #176670 | Hutchinson-gilford progeria syndrome; hgps | P02545 | 
| #145000 | Hyperparathyroidism 1; hrpt1 | O00255 | 
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 | P02545 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada | P02545 | 
| #131100 | Multiple endocrine neoplasia, type i; men1 | O00255 | 
| #613205 | Muscular dystrophy, congenital, lmna-related | P02545 | 
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b | P02545 | 
| #168601 | Parkinson disease 1, autosomal dominant; park1 | P37840 | 
| #605543 | Parkinson disease 4, autosomal dominant; park4 | P37840 | 
| #168600 | Parkinson disease, late-onset; pd | P37840 | 
| #260540 | Parkinson-dementia syndrome | P10636 | 
| #172700 | Pick disease of brain | P10636 | 
| #275210 | Restrictive dermopathy, lethal | P02545 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| #601104 | Supranuclear palsy, progressive, 1; psnp1 | P10636 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00033 | Adrenal carcinoma | O00255
                            (related) | 
| H00034 | Carcinoid | O00255
                            (related) | 
| H00045 | Malignant islet cell carcinoma | O00255
                            (related) | 
| H00246 | Primary hyperparathyroidism | O00255
                            (related) | 
| H01102 | Pituitary adenomas | O00255
                            (related) | 
| H00081 | Hashimoto's thyroiditis | P01215
                            (marker) | 
| H00082 | Graves' disease | P01215
                            (marker) | 
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) | P01215
                            (marker) | 
| H00264 | Charcot-Marie-Tooth disease (CMT) | P02545
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | P02545
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P02545
                            (related) | 
| H00563 | Emery-Dreifuss muscular dystrophy | P02545
                            (related) | 
| H00590 | Congenital muscular dystrophies (CMD/MDC) | P02545
                            (related) | 
| H00593 | Limb-girdle muscular dystrophy (LGMD) | P02545
                            (related) | 
| H00601 | Hutchinson-Gilford progeria syndrome | P02545
                            (related) | 
| H00663 | Restrictive dermopathy | P02545
                            (related) | 
| H00665 | Mandibuloacral dysplasia | P02545
                            (related) | 
| H01216 | Left ventricular noncompaction (LVNC) | P02545
                            (related) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | P10636
                            (related) Q13148 (related) | 
| H00077 | Progressive supranuclear palsy (PSP) | P10636
                            (related) | 
| H00078 | Frontotemporal lobar degeneration (FTLD) | P10636
                            (related) | 
| H00057 | Parkinson's disease (PD) | P37840
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P37840
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q03164
                            (related) Q03164 (marker) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) |