| id | C00007067 |
|---|---|
| Name | 4-Hydroxycordoin |
| CAS RN | 55524-25-9 |
| Standard InChI | InChI=1S/C20H20O4/c1-14(2)11-12-24-17-8-9-18(20(23)13-17)19(22)10-5-15-3-6-16(21)7-4-15/h3-11,13,21,23H,12H2,1-2H3/b10-5+ |
| Standard InChI (Main Layer) | InChI=1S/C20H20O4/c1-14(2)11-12-24-17-8-9-18(20(23)13-17)19(22)10-5-15-3-6-16(21)7-4-15/h3-11,13,21,23H,12H2,1-2H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 133 |
| By standard InChI | CHEMBL460400 |
|---|---|
| By standard InChI Main Layer | CHEMBL460400 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lonchocarpus neuroscapha | 3925 | Fabaceae | rosids | Viridiplantae |
| Millettia ferruginea | 53625 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q96RI1 | Bile acid receptor | NR1H4 | CHEMBL460400 |
CHEMBL2025894
(1)
CHEMBL2025895
(1)
CHEMBL2025896 (1) CHEMBL2025897 (1) CHEMBL2025898 (1) CHEMBL2025899 (1) CHEMBL2025900 (1) CHEMBL2025901 (1) |
0 / 0 |