| id | C00007148 |
|---|---|
| Name | Kuraridin |
| CAS RN | 34981-25-4 |
| Standard InChI | InChI=1S/C26H30O6/c1-15(2)6-7-18(16(3)4)12-20-23(30)14-24(32-5)25(26(20)31)21(28)11-9-17-8-10-19(27)13-22(17)29/h6,8-11,13-14,18,27,29-31H,3,7,12H2,1-2,4-5H3/b11-9+ |
| Standard InChI (Main Layer) | InChI=1S/C26H30O6/c1-15(2)6-7-18(16(3)4)12-20-23(30)14-24(32-5)25(26(20)31)21(28)11-9-17-8-10-19(27)13-22(17)29/h6,8-11,13-14,18,27,29-31H,3,7,12H2,1-2,4-5H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 190 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL243362 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sophora angustifolia | 3896 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL243362 |
CHEMBL892510
(1)
|
1 / 1 |
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL243362 |
CHEMBL892511
(1)
|
1 / 1 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL243362 |
CHEMBL1008496
(1)
|
0 / 0 |