id | C00007209 |
---|---|
Name | alpha-Conidendrin / (-)-alpha-Conidendrin |
CAS RN | 518-55-8 |
Standard InChI | InChI=1S/C20H20O6/c1-24-17-6-10(3-4-15(17)21)19-12-8-16(22)18(25-2)7-11(12)5-13-14(19)9-26-20(13)23/h3-4,6-8,13-14,19,21-22H,5,9H2,1-2H3/t13-,14+,19+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H20O6/c1-24-17-6-10(3-4-15(17)21)19-12-8-16(22)18(25-2)7-11(12)5-13-14(19)9-26-20(13)23/h3-4,6-8,13-14,19,21-22H,5,9H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 406 |
By standard InChI | CHEMBL463246 |
---|---|
By standard InChI Main Layer | CHEMBL463246 |
By LinkDB |
---|
By CAS RN | C421915 |
---|
class name | count |
---|---|
Spermatophyta | 12 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL463246 |
CHEMBL1669910
(1)
|
1 / 0 |
P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL463246 |
CHEMBL1669909
(1)
|
0 / 1 |