| id | C00007209 |
|---|---|
| Name | alpha-Conidendrin / (-)-alpha-Conidendrin |
| CAS RN | 518-55-8 |
| Standard InChI | InChI=1S/C20H20O6/c1-24-17-6-10(3-4-15(17)21)19-12-8-16(22)18(25-2)7-11(12)5-13-14(19)9-26-20(13)23/h3-4,6-8,13-14,19,21-22H,5,9H2,1-2H3/t13-,14+,19+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O6/c1-24-17-6-10(3-4-15(17)21)19-12-8-16(22)18(25-2)7-11(12)5-13-14(19)9-26-20(13)23/h3-4,6-8,13-14,19,21-22H,5,9H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 406 |
| By standard InChI | CHEMBL463246 |
|---|---|
| By standard InChI Main Layer | CHEMBL463246 |
| By LinkDB |
|---|
| By CAS RN | C421915 |
|---|
| class name | count |
|---|---|
| Spermatophyta | 12 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL463246 |
CHEMBL1669910
(1)
|
1 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL463246 |
CHEMBL1669909
(1)
|
0 / 1 |