| id | C00007366 |
|---|---|
| Name | alpha-Tocopherol |
| CAS RN | 59-02-9 |
| Standard InChI | InChI=1S/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3/t21-,22-,29-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1290 |
| By standard InChI | CHEMBL47 |
|---|---|
| By standard InChI Main Layer | CHEMBL47 CHEMBL49563 CHEMBL442800 |
| By LinkDB | C02477 |
|---|
| By CAS RN | D024502 |
|---|
| class name | count |
|---|---|
| rosids | 9 |
| Liliopsida | 7 |
| asterids | 7 |
| eudicotyledons | 3 |
| Magnoliophyta | 2 |
| Viridiplantae | 1 |
| family name | count |
|---|---|
| Poaceae | 5 |
| Apiaceae | 3 |
| Arecaceae | 2 |
| Solanaceae | 1 |
| Annonaceae | 1 |
| Myrtaceae | 1 |
| Proteaceae | 1 |
| Euphorbiaceae | 1 |
| Juglandaceae | 1 |
| Sapindaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL47 CHEMBL442800 |
CHEMBL1741321
(1)
CHEMBL1909136
(2)
|
1 / 0 |
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL47 |
CHEMBL1909139
(2)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL47 |
CHEMBL1909131
(2)
|
0 / 3 |
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL47 |
CHEMBL1909190
(2)
|
2 / 2 |
| P08246 | Neutrophil elastase | S1A | CHEMBL47 |
CHEMBL1909195
(2)
|
2 / 1 |
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL47 |
CHEMBL1909215
(2)
|
0 / 0 |
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL47 |
CHEMBL1909201
(2)
|
0 / 0 |
| P49146 | Neuropeptide Y receptor type 2 | Neuropeptide Y receptor | CHEMBL47 |
CHEMBL1909176
(2)
|
0 / 0 |
| P29466 | Caspase-1 | C14 | CHEMBL47 |
CHEMBL1909193
(2)
|
0 / 0 |
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL47 |
CHEMBL1909198
(2)
|
0 / 0 |
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL47 |
CHEMBL1909199
(2)
|
0 / 0 |
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL47 |
CHEMBL1909197
(2)
|
2 / 2 |
| O75604 | Ubiquitin carboxyl-terminal hydrolase 2 | Enzyme | CHEMBL442800 |
CHEMBL1614331
(1)
|
0 / 0 |
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL47 CHEMBL442800 |
CHEMBL1614544
(2)
|
11 / 10 |
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL442800 |
CHEMBL1613776
(1)
|
3 / 1 |
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL47 |
CHEMBL1909123
(2)
|
1 / 2 |
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL47 |
CHEMBL1909092
(2)
|
0 / 1 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL47 |
CHEMBL1909169
(2)
|
1 / 1 |
| P25021 | Histamine H2 receptor | Histamine receptor | CHEMBL47 |
CHEMBL1909157
(2)
|
0 / 0 |
| P35367 | Histamine H1 receptor | Histamine receptor | CHEMBL47 |
CHEMBL1909156
(2)
|
0 / 0 |
| Q01959 | Sodium-dependent dopamine transporter | Dopamine | CHEMBL47 |
CHEMBL1909143
(2)
|
1 / 0 |
| P08912 | Muscarinic acetylcholine receptor M5 | Acetylcholine receptor | CHEMBL47 |
CHEMBL1909174
(2)
|
0 / 0 |
| P18825 | Alpha-2C adrenergic receptor | Adrenergic receptor | CHEMBL47 |
CHEMBL1909090
(2)
|
0 / 0 |
| P13945 | Beta-3 adrenergic receptor | Adrenergic receptor | CHEMBL47 |
CHEMBL1909093
(2)
|
0 / 0 |
| P25024 | C-X-C chemokine receptor type 1 | CXC chemokine receptor | CHEMBL47 |
CHEMBL1909127
(2)
|
0 / 0 |
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL47 |
CHEMBL1909204
(2)
|
0 / 0 |
| Q08209 | Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform | Ser_Thr | CHEMBL47 |
CHEMBL1909202
(2)
|
0 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL47 CHEMBL442800 |
CHEMBL1614027
(1)
CHEMBL1741325
(1)
CHEMBL1909135 (2) |
0 / 1 |
| P16662 | UDP-glucuronosyltransferase 2B7 | Enzyme | CHEMBL47 |
CHEMBL1908093
(1)
|
0 / 0 |
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL47 |
CHEMBL1909203
(2)
|
1 / 11 |
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL47 |
CHEMBL1909140
(2)
|
2 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL47 |
CHEMBL1909130
(2)
|
0 / 0 |
| P37288 | Vasopressin V1a receptor | Vasopressin and oxytocin receptor | CHEMBL47 |
CHEMBL1909120
(2)
|
0 / 0 |
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL47 |
CHEMBL1909181
(2)
|
0 / 0 |
| Q9Y271 | Cysteinyl leukotriene receptor 1 | Leukotriene receptor | CHEMBL47 |
CHEMBL1909164
(2)
|
0 / 0 |
| P29274 | Adenosine receptor A2a | Adenosine receptor | CHEMBL47 |
CHEMBL1909214
(2)
|
0 / 0 |
| P25929 | Neuropeptide Y receptor type 1 | Neuropeptide Y receptor | CHEMBL47 |
CHEMBL1909175
(2)
|
0 / 0 |
| P50052 | Type-2 angiotensin II receptor | Angiotensin receptor | CHEMBL47 |
CHEMBL1909096
(2)
|
1 / 1 |
| P17948 | Vascular endothelial growth factor receptor 1 | Vegfr | CHEMBL47 |
CHEMBL1909118
(2)
|
0 / 0 |
| P41968 | Melanocortin receptor 3 | Melanocortin receptor | CHEMBL47 |
CHEMBL1909166
(2)
|
1 / 0 |
| P11509 | Cytochrome P450 2A6 | Cytochrome P450 2A6 | CHEMBL47 |
CHEMBL1909133
(2)
|
0 / 0 |
| P04035 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | Oxidoreductase | CHEMBL47 |
CHEMBL1909158
(2)
|
0 / 0 |
| P08913 | Alpha-2A adrenergic receptor | Adrenergic receptor | CHEMBL47 |
CHEMBL1909088
(2)
|
0 / 0 |
| P21917 | D(4) dopamine receptor | Dopamine receptor | CHEMBL47 |
CHEMBL1909142
(2)
|
0 / 0 |
| P30988 | Calcitonin receptor | Calcitonin receptor | CHEMBL47 |
CHEMBL1909101
(2)
|
0 / 0 |
| P35462 | D(3) dopamine receptor | Dopamine receptor | CHEMBL47 |
CHEMBL1909141
(2)
|
1 / 0 |
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL47 |
CHEMBL1909180
(2)
|
0 / 0 |
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL47 |
CHEMBL1909146
(2)
|
0 / 1 |
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL47 |
CHEMBL1909104
(2)
|
0 / 0 |
| P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL47 |
CHEMBL1909144
(2)
|
0 / 0 |
| P30411 | B2 bradykinin receptor | Bradykinin receptor | CHEMBL47 |
CHEMBL1909100
(2)
|
0 / 0 |
| P32245 | Melanocortin receptor 4 | Melanocortin receptor | CHEMBL47 |
CHEMBL1909167
(2)
|
1 / 0 |
| P32238 | Cholecystokinin receptor type A | Cholecystokinin receptor | CHEMBL47 |
CHEMBL1909129
(2)
|
0 / 0 |
| P08311 | Cathepsin G | S1A | CHEMBL47 |
CHEMBL1909194
(2)
|
0 / 0 |
| Q99720 | Sigma non-opioid intracellular receptor 1 | Membrane receptor | CHEMBL47 |
CHEMBL1909110
(2)
|
1 / 0 |
| P03956 | Interstitial collagenase | M10A | CHEMBL47 |
CHEMBL1909196
(2)
|
0 / 1 |
| P32241 | Vasoactive intestinal polypeptide receptor 1 | Vasoactive intestinal peptide receptor | CHEMBL47 |
CHEMBL1909119
(2)
|
0 / 0 |
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL47 CHEMBL49563 CHEMBL442800 |
CHEMBL1794467
(4)
|
0 / 0 |
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL47 |
CHEMBL1909150
(2)
|
0 / 1 |
| P08172 | Muscarinic acetylcholine receptor M2 | Acetylcholine receptor | CHEMBL47 |
CHEMBL1909171
(2)
|
2 / 0 |
| P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL47 |
CHEMBL1909170
(2)
|
0 / 0 |
| P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL47 |
CHEMBL1909122
(2)
|
0 / 0 |
| P31645 | Sodium-dependent serotonin transporter | Serotonin | CHEMBL47 |
CHEMBL1909109
(2)
|
2 / 0 |
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL47 |
CHEMBL1909205
(2)
|
5 / 10 |
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL47 |
CHEMBL1909172
(2)
|
1 / 0 |
| P21452 | Substance-K receptor | Neurokinin receptor | CHEMBL47 |
CHEMBL1909114
(2)
|
0 / 0 |
| P51679 | C-C chemokine receptor type 4 | CC chemokine receptor | CHEMBL47 |
CHEMBL1909125
(2)
|
0 / 0 |
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL47 |
CHEMBL1909126
(2)
|
3 / 0 |
| P50406 | 5-hydroxytryptamine receptor 6 | Serotonin receptor | CHEMBL47 |
CHEMBL1909108
(2)
|
0 / 0 |
| P41597 | C-C chemokine receptor type 2 | CC chemokine receptor | CHEMBL47 |
CHEMBL1909124
(2)
|
1 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL47 |
CHEMBL1909200
(2)
|
0 / 0 |
| P08575 | Receptor-type tyrosine-protein phosphatase C | Enzyme | CHEMBL47 |
CHEMBL1909207
(2)
|
2 / 1 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL47 CHEMBL442800 |
CHEMBL1741322
(1)
CHEMBL1909132
(2)
|
0 / 0 |
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL47 |
CHEMBL1909186
(2)
|
0 / 0 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL47 |
CHEMBL1909145
(2)
|
1 / 1 |
| P08588 | Beta-1 adrenergic receptor | Adrenergic receptor | CHEMBL47 |
CHEMBL1909091
(2)
|
1 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL47 |
CHEMBL1909212
(2)
|
1 / 0 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL47 |
CHEMBL1909211
(2)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL47 |
CHEMBL1909105
(2)
|
0 / 0 |
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL47 |
CHEMBL1909182
(2)
|
0 / 0 |
| P08173 | Muscarinic acetylcholine receptor M4 | Acetylcholine receptor | CHEMBL47 |
CHEMBL1909173
(2)
|
0 / 0 |
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL47 |
CHEMBL1909113
(2)
|
0 / 0 |
| P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL47 |
CHEMBL1909187
(2)
|
0 / 0 |
| P33032 | Melanocortin receptor 5 | Melanocortin receptor | CHEMBL47 |
CHEMBL1909168
(2)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL47 CHEMBL442800 |
CHEMBL1613777
(1)
CHEMBL1741323
(1)
CHEMBL1909134 (2) |
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL47 CHEMBL442800 |
CHEMBL1741324
(1)
CHEMBL1743290
(1)
CHEMBL1909138 (2) |
0 / 1 |
| P05181 | Cytochrome P450 2E1 | Cytochrome P450 2E1 | CHEMBL47 |
CHEMBL1909137
(2)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL442800 |
CHEMBL1614211
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL47 CHEMBL49563 |
CHEMBL1614250
(1)
CHEMBL1614502
(1)
|
4 / 3 |
| P23975 | Sodium-dependent noradrenaline transporter | Norepinephrine | CHEMBL47 |
CHEMBL1909094
(2)
|
1 / 1 |
| P25100 | Alpha-1D adrenergic receptor | Adrenergic receptor | CHEMBL47 |
CHEMBL1909087
(2)
|
0 / 0 |
| P30542 | Adenosine receptor A1 | Adenosine receptor | CHEMBL47 |
CHEMBL1909213
(2)
|
0 / 0 |
| P18089 | Alpha-2B adrenergic receptor | Adrenergic receptor | CHEMBL47 |
CHEMBL1909089
(2)
|
0 / 0 |
| P24557 | Thromboxane-A synthase | Cytochrome P450 5A1 | CHEMBL47 |
CHEMBL1909116
(2)
|
1 / 1 |
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL47 |
CHEMBL1909206
(2)
|
0 / 1 |
| P25025 | C-X-C chemokine receptor type 2 | CXC chemokine receptor | CHEMBL47 |
CHEMBL1909128
(2)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL49563 |
CHEMBL1794536
(1)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL47 |
CHEMBL1614531
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL47 |
CHEMBL1614531
(1)
|
1 / 3 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| D024502 | 335 |
APOA1
|
apolipoprotein A-I | alpha-Tocopherol results in decreased expression of APOA1 mRNA |
decreases expression
|
mRNA |
16423621
|
| D024502 | 335 |
APOA1
|
apolipoprotein A-I | alpha-Tocopherol results in decreased expression of APOA1 protein |
decreases expression
|
protein |
16423621
|
| D024502 | 338 |
APOB
FLDB LDLCQ4 |
apolipoprotein B | alpha-Tocopherol promotes the reaction [APOB protein results in increased reduction of Copper] |
increases reaction
/ increases reduction |
protein |
11368321
|
| D024502 | 351 |
APP
AAA ABETA ABPP AD1 APPI CTFgamma CVAP PN-II PN2 |
amyloid beta (A4) precursor protein | alpha-Tocopherol inhibits the reaction [APP protein results in increased activity of MAPK14 protein] |
decreases reaction
/ increases activity |
protein |
12684028
|
| D024502 | 351 |
APP
AAA ABETA ABPP AD1 APPI CTFgamma CVAP PN-II PN2 |
amyloid beta (A4) precursor protein | alpha-Tocopherol inhibits the reaction [APP protein results in increased activity of MAPK8 protein] |
decreases reaction
/ increases activity |
protein |
12684028
|
| D024502 | 1386 |
ATF2
CRE-BP1 CREB2 HB16 TREB7 |
activating transcription factor 2 (EC:2.3.1.48) | alpha-Tocopherol inhibits the reaction [Tamoxifen results in increased phosphorylation of ATF2 protein] |
decreases reaction
/ increases phosphorylation |
protein |
14645110
|
| D024502 | 23621 |
BACE1
ASP2 BACE HSPC104 |
beta-site APP-cleaving enzyme 1 (EC:3.4.23.46) | alpha-Tocopherol inhibits the reaction [Oxygen deficiency results in increased expression of BACE1 mRNA] |
decreases reaction
/ increases expression |
mRNA |
19196431
|
| D024502 | 581 |
BAX
BCL2L4 |
BCL2-associated X protein | alpha-Tocopherol affects the reaction [Lipopolysaccharides results in increased expression of BAX protein] |
affects reaction
/ increases expression |
protein |
11805214
|
| D024502 | 596 |
BCL2
Bcl-2 PPP1R50 |
B-cell CLL/lymphoma 2 | alpha-Tocopherol affects the reaction [Lipopolysaccharides results in decreased expression of BCL2 protein] |
affects reaction
/ decreases expression |
protein |
11805214
|
| D024502 | 596 |
BCL2
Bcl-2 PPP1R50 |
B-cell CLL/lymphoma 2 | alpha-Tocopherol analog results in decreased expression of BCL2 mRNA |
decreases expression
|
mRNA |
20686688
|
| D024502 | 596 |
BCL2
Bcl-2 PPP1R50 |
B-cell CLL/lymphoma 2 | alpha-Tocopherol analog results in decreased expression of BCL2 protein |
decreases expression
|
protein |
20686688
|
| D024502 | 596 |
BCL2
Bcl-2 PPP1R50 |
B-cell CLL/lymphoma 2 | benzyloxycarbonyl-isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone inhibits the reaction [alpha-Tocopherol analog results in decreased expression of BCL2 protein] |
decreases expression
/ decreases reaction |
protein |
20686688
|
| D024502 | 596 |
BCL2
Bcl-2 PPP1R50 |
B-cell CLL/lymphoma 2 | DDIT3 mRNA affects the reaction [alpha-Tocopherol analog results in decreased expression of BCL2 protein] |
affects reaction
/ decreases expression |
protein |
20686688
|
| D024502 | 596 |
BCL2
Bcl-2 PPP1R50 |
B-cell CLL/lymphoma 2 | salubrinal inhibits the reaction [alpha-Tocopherol analog results in decreased expression of BCL2 protein] |
decreases expression
/ decreases reaction |
protein |
20686688
|
| D024502 | 596 |
BCL2
Bcl-2 PPP1R50 |
B-cell CLL/lymphoma 2 | TNFRSF10B mRNA affects the reaction [alpha-Tocopherol analog results in decreased expression of BCL2 protein] |
affects reaction
/ decreases expression |
protein |
20686688
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | [alpha-Tocopherol co-treated with beta-ionone] results in increased activity of CASP3 protein |
affects cotreatment
/ increases activity |
protein |
17618090
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | [alpha-Tocopherol co-treated with Tretinoin] results in increased activity of CASP3 protein |
affects cotreatment
/ increases activity |
protein |
17874176
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | alpha-Tocopherol inhibits the reaction [7-ketocholesterol results in increased activity of CASP3 protein] |
decreases reaction
/ increases activity |
protein |
12450566
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | alpha-Tocopherol inhibits the reaction [Acetaldehyde results in increased activity of CASP3 protein] |
decreases reaction
/ increases activity |
protein |
14722101
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | alpha-Tocopherol inhibits the reaction [cholest-5-en-3 beta,7 alpha-diol results in increased activity of CASP3 protein] |
decreases reaction
/ increases activity |
protein |
12450566
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | alpha-Tocopherol inhibits the reaction [Vitamin A results in increased activity of CASP3 protein] |
decreases reaction
/ increases activity |
protein |
17618090
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | alpha-Tocopherol promotes the reaction [Amiodarone results in increased activity of CASP3 protein] |
increases activity
/ increases reaction |
protein |
23042730
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | alpha-Tocopherol promotes the reaction [beta Carotene metabolite results in decreased activity of CASP3 protein] |
decreases activity
/ increases reaction |
protein |
17618090
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | alpha-Tocopherol promotes the reaction [TNF protein promotes the reaction [Amiodarone results in increased activity of CASP3 protein]] |
increases activity
/ increases reaction |
protein |
23042730
|
| D024502 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | alpha-Tocopherol results in decreased activity of CASP3 protein |
decreases activity
|
protein |
15095415
17618090 |
| D024502 | 840 |
CASP7
CASP-7 CMH-1 ICE-LAP3 LICE2 MCH3 |
caspase 7, apoptosis-related cysteine peptidase (EC:3.4.22.60) | alpha-Tocopherol promotes the reaction [Amiodarone results in increased activity of CASP7 protein] |
increases activity
/ increases reaction |
protein |
23042730
|
| D024502 | 840 |
CASP7
CASP-7 CMH-1 ICE-LAP3 LICE2 MCH3 |
caspase 7, apoptosis-related cysteine peptidase (EC:3.4.22.60) | alpha-Tocopherol promotes the reaction [TNF protein promotes the reaction [Amiodarone results in increased activity of CASP7 protein]] |
increases activity
/ increases reaction |
protein |
23042730
|
| D024502 | 841 |
CASP8
ALPS2B CAP4 Casp-8 FLICE MACH MCH5 |
caspase 8, apoptosis-related cysteine peptidase (EC:3.4.22.61) | alpha-Tocopherol analog results in increased cleavage of CASP8 protein |
increases cleavage
|
protein |
20686688
|
| D024502 | 842 |
CASP9
APAF-3 APAF3 ICE-LAP6 MCH6 PPP1R56 |
caspase 9, apoptosis-related cysteine peptidase (EC:3.4.22.62) | alpha-Tocopherol analog results in increased cleavage of CASP9 protein |
increases cleavage
|
protein |
20686688
|
| D024502 | 847 |
CAT
|
catalase (EC:1.11.1.6) | alpha-Tocopherol results in increased expression of CAT mRNA |
increases expression
|
mRNA |
19083475
|
| D024502 | 847 |
CAT
|
catalase (EC:1.11.1.6) | alpha-Tocopherol results in increased expression of CAT protein |
increases expression
|
protein |
19083475
|
| D024502 | 1080 |
CFTR
ABC35 ABCC7 CF CFTR/MRP MRP7 TNR-CFTR dJ760C5.1 |
cystic fibrosis transmembrane conductance regulator (ATP-binding cassette sub-family C, member 7) (EC:3.6.3.49) | alpha-Tocopherol inhibits the reaction [Cadmium results in decreased expression of CFTR protein] |
decreases expression
/ decreases reaction |
protein |
20363832
|
| D024502 | 1382 |
CRABP2
CRABP-II RBP6 |
cellular retinoic acid binding protein 2 | [Tretinoin co-treated with alpha-Tocopherol] results in increased expression of CRABP2 mRNA |
affects cotreatment
/ increases expression |
mRNA |
15225641
|
| D024502 | 1382 |
CRABP2
CRABP-II RBP6 |
cellular retinoic acid binding protein 2 | [Tretinoin co-treated with alpha-Tocopherol] results in increased expression of CRABP2 protein |
affects cotreatment
/ increases expression |
protein |
15225641
|
| D024502 | 1401 |
CRP
PTX1 |
C-reactive protein, pentraxin-related | [alpha-Tocopherol co-treated with gamma-Tocopherol] results in decreased expression of CRP protein |
affects cotreatment
/ decreases expression |
protein |
18191645
|
| D024502 | 1649 |
DDIT3
CEBPZ CHOP CHOP-10 CHOP10 GADD153 |
DNA-damage-inducible transcript 3 | alpha-Tocopherol analog results in increased expression of DDIT3 protein |
increases expression
|
protein |
20686688
|
| D024502 | 1649 |
DDIT3
CEBPZ CHOP CHOP-10 CHOP10 GADD153 |
DNA-damage-inducible transcript 3 | benzyloxycarbonyl-isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone inhibits the reaction [alpha-Tocopherol analog results in increased expression of DDIT3 protein] |
decreases reaction
/ increases expression |
protein |
20686688
|
| D024502 | 1649 |
DDIT3
CEBPZ CHOP CHOP-10 CHOP10 GADD153 |
DNA-damage-inducible transcript 3 | DDIT3 mRNA affects the reaction [alpha-Tocopherol analog results in decreased expression of BCL2 protein] |
affects reaction
/ decreases expression |
mRNA |
20686688
|
| D024502 | 1649 |
DDIT3
CEBPZ CHOP CHOP-10 CHOP10 GADD153 |
DNA-damage-inducible transcript 3 | salubrinal inhibits the reaction [alpha-Tocopherol analog results in increased expression of DDIT3 protein] |
decreases reaction
/ increases expression |
protein |
20686688
|
| D024502 | 83939 |
EIF2A
EIF-2A MST089 MSTP004 MSTP089 |
eukaryotic translation initiation factor 2A, 65kDa | alpha-Tocopherol analog results in increased phosphorylation of EIF2A protein |
increases phosphorylation
|
protein |
20686688
|
| D024502 | 83939 |
EIF2A
EIF-2A MST089 MSTP004 MSTP089 |
eukaryotic translation initiation factor 2A, 65kDa | benzyloxycarbonyl-isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone inhibits the reaction [alpha-Tocopherol analog results in increased phosphorylation of EIF2A protein] |
decreases reaction
/ increases phosphorylation |
protein |
20686688
|
| D024502 | 83939 |
EIF2A
EIF-2A MST089 MSTP004 MSTP089 |
eukaryotic translation initiation factor 2A, 65kDa | salubrinal inhibits the reaction [alpha-Tocopherol analog results in increased phosphorylation of EIF2A protein] |
decreases reaction
/ increases phosphorylation |
protein |
20686688
|
| D024502 | 2335 |
FN1
CIG ED-B FINC FN FNZ GFND GFND2 LETS MSF |
fibronectin 1 | alpha-Tocopherol inhibits the reaction [Glucose results in increased expression of and results in increased secretion of FN1 protein] |
decreases reaction
/ increases expression / increases secretion |
protein |
9225831
|
| D024502 | 2534 |
FYN
SLK SYN p59-FYN |
FYN oncogene related to SRC, FGR, YES (EC:2.7.10.2) | alpha-Tocopherol inhibits the reaction [bis(2-hydroxy-2-ethylbutanoato)oxochromate(V) results in increased phosphorylation of FYN protein] |
decreases reaction
/ increases phosphorylation |
protein |
14572611
|
| D024502 | 2534 |
FYN
SLK SYN p59-FYN |
FYN oncogene related to SRC, FGR, YES (EC:2.7.10.2) | alpha-Tocopherol inhibits the reaction [Potassium Dichromate results in increased phosphorylation of FYN protein] |
decreases reaction
/ increases phosphorylation |
protein |
14572611
|
| D024502 | 2879 |
GPX4
GPx-4 GSHPx-4 MCSP PHGPx snGPx snPHGPx |
glutathione peroxidase 4 (EC:1.11.1.12) | alpha-Tocopherol inhibits the reaction [Sodium Selenite results in increased expression of GPX4 mRNA] |
decreases reaction
/ increases expression |
mRNA |
14642406
|
| D024502 | 3048 |
HBG2
TNCY |
hemoglobin, gamma G | alpha-Tocopherol results in increased expression of HBG2 protein |
increases expression
|
protein |
2606537
|
| D024502 | 3162 |
HMOX1
HMOX1D HO-1 HSP32 bK286B10 |
heme oxygenase (decycling) 1 (EC:1.14.99.3) | alpha-Tocopherol affects the expression of HMOX1 mRNA |
affects expression
|
mRNA |
8743975
|
| D024502 | 3162 |
HMOX1
HMOX1D HO-1 HSP32 bK286B10 |
heme oxygenase (decycling) 1 (EC:1.14.99.3) | alpha-Tocopherol inhibits the reaction [benzo(a)pyrene-7,8-dione results in increased expression of HMOX1 protein] |
decreases reaction
/ increases expression |
protein |
22053912
|
| D024502 | 3240 |
HP
BP HP2ALPHA2 HPA1S |
haptoglobin | alpha-Tocopherol affects the activity of HP protein polymorphism |
affects activity
|
protein |
19769483
|
| D024502 | 3383 |
ICAM1
BB2 CD54 P3.58 |
intercellular adhesion molecule 1 | alpha-Tocopherol inhibits the reaction [Vehicle Emissions results in increased expression of ICAM1 protein] |
decreases reaction
/ increases expression |
protein |
22313677
|
| D024502 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | alpha-Tocopherol inhibits the reaction [Tetradecanoylphorbol Acetate results in increased secretion of IL8 protein] |
decreases reaction
/ increases secretion |
protein |
19135038
|
| D024502 | 3725 |
JUN
AP-1 AP1 c-Jun |
jun proto-oncogene | alpha-Tocopherol inhibits the reaction [Tamoxifen results in increased phosphorylation of JUN protein] |
decreases reaction
/ increases phosphorylation |
protein |
14645110
|
| D024502 | 3932 |
LCK
LSK YT16 p56lck pp58lck |
lymphocyte-specific protein tyrosine kinase (EC:2.7.10.2) | alpha-Tocopherol inhibits the reaction [bis(2-hydroxy-2-ethylbutanoato)oxochromate(V) results in increased phosphorylation of LCK protein] |
decreases reaction
/ increases phosphorylation |
protein |
14572611
|
| D024502 | 3932 |
LCK
LSK YT16 p56lck pp58lck |
lymphocyte-specific protein tyrosine kinase (EC:2.7.10.2) | alpha-Tocopherol inhibits the reaction [Potassium Dichromate results in increased phosphorylation of LCK protein] |
decreases reaction
/ increases phosphorylation |
protein |
14572611
|
| D024502 | 4067 |
LYN
JTK8 p53Lyn p56Lyn |
v-yes-1 Yamaguchi sarcoma viral related oncogene homolog (EC:2.7.10.2) | alpha-Tocopherol inhibits the reaction [bis(2-hydroxy-2-ethylbutanoato)oxochromate(V) results in increased phosphorylation of LYN protein] |
decreases reaction
/ increases phosphorylation |
protein |
14572611
|
| D024502 | 4067 |
LYN
JTK8 p53Lyn p56Lyn |
v-yes-1 Yamaguchi sarcoma viral related oncogene homolog (EC:2.7.10.2) | alpha-Tocopherol inhibits the reaction [Potassium Dichromate results in increased phosphorylation of LYN protein] |
decreases reaction
/ increases phosphorylation |
protein |
14572611
|
| D024502 | 5594 |
MAPK1
ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk |
mitogen-activated protein kinase 1 (EC:2.7.11.24) | alpha-Tocopherol inhibits the reaction [Tamoxifen results in decreased phosphorylation of MAPK1 protein] |
decreases phosphorylation
/ decreases reaction |
protein |
17011908
|
| D024502 | 1432 |
MAPK14
CSBP CSBP1 CSBP2 CSPB1 EXIP Mxi2 PRKM14 PRKM15 RK SAPK2A p38 p38ALPHA |
mitogen-activated protein kinase 14 (EC:2.7.11.24) | alpha-Tocopherol inhibits the reaction [[4-hydroxy-2-nonenal co-treated with Hydrogen Peroxide] results in increased activity of MAPK14 protein] |
affects cotreatment
/ decreases reaction / increases activity |
protein |
12684028
|
| D024502 | 1432 |
MAPK14
CSBP CSBP1 CSBP2 CSPB1 EXIP Mxi2 PRKM14 PRKM15 RK SAPK2A p38 p38ALPHA |
mitogen-activated protein kinase 14 (EC:2.7.11.24) | alpha-Tocopherol inhibits the reaction [APP protein results in increased activity of MAPK14 protein] |
decreases reaction
/ increases activity |
protein |
12684028
|
| D024502 | 1432 |
MAPK14
CSBP CSBP1 CSBP2 CSPB1 EXIP Mxi2 PRKM14 PRKM15 RK SAPK2A p38 p38ALPHA |
mitogen-activated protein kinase 14 (EC:2.7.11.24) | alpha-Tocopherol inhibits the reaction [Tamoxifen results in increased activity of MAPK14 protein] |
decreases reaction
/ increases activity |
protein |
14645110
|
| D024502 | 5595 |
MAPK3
ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK |
mitogen-activated protein kinase 3 (EC:2.7.11.24) | alpha-Tocopherol inhibits the reaction [Tamoxifen results in decreased phosphorylation of MAPK3 protein] |
decreases phosphorylation
/ decreases reaction |
protein |
17011908
|
| D024502 | 5595 |
MAPK3
ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK |
mitogen-activated protein kinase 3 (EC:2.7.11.24) | alpha-Tocopherol inhibits the reaction [Tamoxifen results in increased activity of MAPK3 protein] |
decreases reaction
/ increases activity |
protein |
14645110
|
| D024502 | 5599 |
MAPK8
JNK JNK-46 JNK1 JNK1A2 JNK21B1/2 PRKM8 SAPK1 SAPK1c |
mitogen-activated protein kinase 8 (EC:2.7.11.24) | alpha-Tocopherol analog results in increased phosphorylation of MAPK8 protein |
increases phosphorylation
|
protein |
20686688
|
| D024502 | 5599 |
MAPK8
JNK JNK-46 JNK1 JNK1A2 JNK21B1/2 PRKM8 SAPK1 SAPK1c |
mitogen-activated protein kinase 8 (EC:2.7.11.24) | alpha-Tocopherol inhibits the reaction [APP protein results in increased activity of MAPK8 protein] |
decreases reaction
/ increases activity |
protein |
12684028
|
| D024502 | 5599 |
MAPK8
JNK JNK-46 JNK1 JNK1A2 JNK21B1/2 PRKM8 SAPK1 SAPK1c |
mitogen-activated protein kinase 8 (EC:2.7.11.24) | alpha-Tocopherol inhibits the reaction [Tamoxifen results in increased activity of MAPK8 protein] |
decreases reaction
/ increases activity |
protein |
14645110
|
| D024502 | 5599 |
MAPK8
JNK JNK-46 JNK1 JNK1A2 JNK21B1/2 PRKM8 SAPK1 SAPK1c |
mitogen-activated protein kinase 8 (EC:2.7.11.24) | benzyloxycarbonyl-isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone inhibits the reaction [alpha-Tocopherol analog results in increased phosphorylation of MAPK8 protein] |
decreases reaction
/ increases phosphorylation |
protein |
20686688
|
| D024502 | 5599 |
MAPK8
JNK JNK-46 JNK1 JNK1A2 JNK21B1/2 PRKM8 SAPK1 SAPK1c |
mitogen-activated protein kinase 8 (EC:2.7.11.24) | salubrinal inhibits the reaction [alpha-Tocopherol analog results in increased phosphorylation of MAPK8 protein] |
decreases reaction
/ increases phosphorylation |
protein |
20686688
|
| D024502 | 5601 |
MAPK9
JNK-55 JNK2 JNK2A JNK2ALPHA JNK2B JNK2BETA PRKM9 SAPK SAPK1a p54a p54aSAPK |
mitogen-activated protein kinase 9 (EC:2.7.11.24) | alpha-Tocopherol analog results in increased phosphorylation of MAPK9 protein |
increases phosphorylation
|
protein |
20686688
|
| D024502 | 5601 |
MAPK9
JNK-55 JNK2 JNK2A JNK2ALPHA JNK2B JNK2BETA PRKM9 SAPK SAPK1a p54a p54aSAPK |
mitogen-activated protein kinase 9 (EC:2.7.11.24) | benzyloxycarbonyl-isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone inhibits the reaction [alpha-Tocopherol analog results in increased phosphorylation of MAPK9 protein] |
decreases reaction
/ increases phosphorylation |
protein |
20686688
|
| D024502 | 5601 |
MAPK9
JNK-55 JNK2 JNK2A JNK2ALPHA JNK2B JNK2BETA PRKM9 SAPK SAPK1a p54a p54aSAPK |
mitogen-activated protein kinase 9 (EC:2.7.11.24) | salubrinal inhibits the reaction [alpha-Tocopherol analog results in increased phosphorylation of MAPK9 protein] |
decreases reaction
/ increases phosphorylation |
protein |
20686688
|
| D024502 | 4155 |
MBP
|
myelin basic protein | alpha-Tocopherol inhibits the reaction [Tamoxifen results in increased expression of MBP protein] |
decreases reaction
/ increases expression |
protein |
14645110
|
| D024502 | 4790 |
NFKB1
EBP-1 KBF1 NF-kB1 NF-kappa-B NF-kappaB NFKB-p105 NFKB-p50 NFkappaB p105 p50 |
nuclear factor of kappa light polypeptide gene enhancer in B-cells 1 | alpha-Tocopherol results in increased activity of NFKB1 protein |
increases activity
|
protein |
19083475
|
| D024502 | 4846 |
NOS3
ECNOS eNOS |
nitric oxide synthase 3 (endothelial cell) (EC:1.14.13.39) | alpha-Tocopherol results in increased expression of NOS3 mRNA |
increases expression
|
mRNA |
16949522
|
| D024502 | 4846 |
NOS3
ECNOS eNOS |
nitric oxide synthase 3 (endothelial cell) (EC:1.14.13.39) | alpha-Tocopherol results in increased expression of NOS3 protein |
increases expression
|
protein |
16949522
|
| D024502 | 11315 |
PARK7
DJ-1 DJ1 |
parkinson protein 7 | alpha-Tocopherol inhibits the reaction [Rotenone affects the localization of PARK7 protein] |
affects localization
/ decreases reaction |
protein |
16439141
|
| D024502 | 142 |
PARP1
ADPRT ADPRT_1 ADPRT1 ARTD1 PARP PARP-1 PPOL pADPRT-1 |
poly (ADP-ribose) polymerase 1 (EC:2.4.2.30) | alpha-Tocopherol inhibits the reaction [Tamoxifen results in increased cleavage of PARP1 protein] |
decreases reaction
/ increases cleavage |
protein |
14645110
|
| D024502 | 5230 |
PGK1
MIG10 PGKA |
phosphoglycerate kinase 1 (EC:2.7.2.3) | alpha-Tocopherol inhibits the reaction [Hydrogen Peroxide results in increased expression of PGK1 protein] |
decreases reaction
/ increases expression |
protein |
18603805
|
| D024502 | 5340 |
PLG
|
plasminogen (EC:3.4.21.7) | alpha-Tocopherol inhibits the reaction [Arsenic promotes the reaction [Humic Substances results in decreased activity of PLG protein]] |
decreases activity
/ decreases reaction / increases reaction |
protein |
11419606
|
| D024502 | 5340 |
PLG
|
plasminogen (EC:3.4.21.7) | alpha-Tocopherol inhibits the reaction [Humic Substances results in decreased activity of PLG protein] |
decreases activity
/ decreases reaction |
protein |
11419606
|
| D024502 | 5468 |
PPARG
CIMT1 GLM1 NR1C3 PPARG1 PPARG2 PPARgamma |
peroxisome proliferator-activated receptor gamma | alpha-Tocopherol results in increased activity of PPARG protein |
increases activity
|
protein |
19083475
|
| D024502 | 5468 |
PPARG
CIMT1 GLM1 NR1C3 PPARG1 PPARG2 PPARgamma |
peroxisome proliferator-activated receptor gamma | alpha-Tocopherol results in increased expression of PPARG mRNA |
increases expression
|
mRNA |
14521714
|
| D024502 | 5468 |
PPARG
CIMT1 GLM1 NR1C3 PPARG1 PPARG2 PPARgamma |
peroxisome proliferator-activated receptor gamma | alpha-Tocopherol results in increased expression of PPARG protein |
increases expression
|
protein |
14521714
|
| D024502 | 5743 |
PTGS2
COX-2 COX2 GRIPGHS PGG/HS PGHS-2 PHS-2 hCox-2 |
prostaglandin-endoperoxide synthase 2 (prostaglandin G/H synthase and cyclooxygenase) (EC:1.14.99.1) | alpha-Tocopherol metabolite results in decreased activity of PTGS2 protein |
decreases activity
|
protein |
15225597
|
| D024502 | 5743 |
PTGS2
COX-2 COX2 GRIPGHS PGG/HS PGHS-2 PHS-2 hCox-2 |
prostaglandin-endoperoxide synthase 2 (prostaglandin G/H synthase and cyclooxygenase) (EC:1.14.99.1) | alpha-Tocopherol results in decreased activity of PTGS2 protein |
decreases activity
|
protein |
15225597
|
| D024502 | 5970 |
RELA
NFKB3 p65 |
v-rel avian reticuloendotheliosis viral oncogene homolog A | alpha-Tocopherol affects the localization of RELA protein |
affects localization
|
protein |
16882165
|
| D024502 | 6256 |
RXRA
NR2B1 |
retinoid X receptor, alpha | [Tretinoin co-treated with alpha-Tocopherol co-treated with Okadaic Acid] results in decreased phosphorylation of RXRA protein |
affects cotreatment
/ decreases phosphorylation |
protein |
15225641
|
| D024502 | 6256 |
RXRA
NR2B1 |
retinoid X receptor, alpha | [Tretinoin co-treated with alpha-Tocopherol] results in decreased phosphorylation of RXRA protein |
affects cotreatment
/ decreases phosphorylation |
protein |
15225641
|
| D024502 | 6401 |
SELE
CD62E ELAM ELAM1 ESEL LECAM2 |
selectin E | alpha-Tocopherol inhibits the reaction [Hydrogen Peroxide results in increased expression of SELE protein] |
decreases reaction
/ increases expression |
protein |
12566129
|
| D024502 | 4089 |
SMAD4
DPC4 JIP MADH4 MYHRS |
SMAD family member 4 | SMAD4 results in decreased susceptibility to [Fluorouracil co-treated with alpha-Tocopherol] |
affects cotreatment
/ decreases response to substance |
20562578
|
|
| D024502 | 6622 |
SNCA
NACP PARK1 PARK4 PD1 |
synuclein, alpha (non A4 component of amyloid precursor) | alpha-Tocopherol inhibits the reaction [Rotenone results in increased expression of SNCA protein] |
decreases reaction
/ increases expression |
protein |
16439141
|
| D024502 | 6647 |
SOD1
ALS ALS1 IPOA SOD hSod1 homodimer |
superoxide dismutase 1, soluble (EC:1.15.1.1) | alpha-Tocopherol results in increased expression of SOD1 mRNA |
increases expression
|
mRNA |
19083475
|
| D024502 | 6647 |
SOD1
ALS ALS1 IPOA SOD hSod1 homodimer |
superoxide dismutase 1, soluble (EC:1.15.1.1) | alpha-Tocopherol results in increased expression of SOD1 protein |
increases expression
|
protein |
19083475
|
| D024502 | 7015 |
TERT
CMM9 DKCA2 DKCB4 EST2 PFBMFT1 TCS1 TP2 TRT hEST2 hTRT |
telomerase reverse transcriptase (EC:2.7.7.49) | alpha-Tocopherol inhibits the reaction [Hydrogen Peroxide results in decreased activity of TERT protein] |
decreases activity
/ decreases reaction |
protein |
20112180
|
| D024502 | 7124 |
TNF
DIF TNF-alpha TNFA TNFSF2 |
tumor necrosis factor | [alpha-Tocopherol co-treated with gamma-Tocopherol] results in decreased expression of TNF protein |
affects cotreatment
/ decreases expression |
protein |
18191645
|
| D024502 | 7124 |
TNF
DIF TNF-alpha TNFA TNFSF2 |
tumor necrosis factor | alpha-Tocopherol inhibits the reaction [Lipopolysaccharides results in increased expression of TNF protein] |
decreases reaction
/ increases expression |
protein |
11805214
|
| D024502 | 7124 |
TNF
DIF TNF-alpha TNFA TNFSF2 |
tumor necrosis factor | alpha-Tocopherol inhibits the reaction [Tetradecanoylphorbol Acetate results in increased secretion of TNF protein] |
decreases reaction
/ increases secretion |
protein |
19135038
|
| D024502 | 7124 |
TNF
DIF TNF-alpha TNFA TNFSF2 |
tumor necrosis factor | alpha-Tocopherol inhibits the reaction [TNF protein results in increased abundance of Reactive Oxygen Species] |
decreases reaction
/ increases abundance |
protein |
16750838
|
| D024502 | 7124 |
TNF
DIF TNF-alpha TNFA TNFSF2 |
tumor necrosis factor | alpha-Tocopherol promotes the reaction [TNF protein promotes the reaction [Amiodarone results in increased activity of CASP3 protein]] |
increases activity
/ increases reaction |
protein |
23042730
|
| D024502 | 7124 |
TNF
DIF TNF-alpha TNFA TNFSF2 |
tumor necrosis factor | alpha-Tocopherol promotes the reaction [TNF protein promotes the reaction [Amiodarone results in increased activity of CASP7 protein]] |
increases activity
/ increases reaction |
protein |
23042730
|
| D024502 | 7124 |
TNF
DIF TNF-alpha TNFA TNFSF2 |
tumor necrosis factor | alpha-Tocopherol results in decreased expression of TNF protein |
decreases expression
|
protein |
18191645
|
| D024502 | 8795 |
TNFRSF10B
CD262 DR5 KILLER KILLER/DR5 TRAIL-R2 TRAILR2 TRICK2 TRICK2A TRICK2B TRICKB ZTNFR9 |
tumor necrosis factor receptor superfamily, member 10b | alpha-Tocopherol analog results in increased expression of TNFRSF10B mRNA |
increases expression
|
mRNA |
20686688
|
| D024502 | 8795 |
TNFRSF10B
CD262 DR5 KILLER KILLER/DR5 TRAIL-R2 TRAILR2 TRICK2 TRICK2A TRICK2B TRICKB ZTNFR9 |
tumor necrosis factor receptor superfamily, member 10b | alpha-Tocopherol analog results in increased expression of TNFRSF10B protein |
increases expression
|
protein |
20686688
|
| D024502 | 8795 |
TNFRSF10B
CD262 DR5 KILLER KILLER/DR5 TRAIL-R2 TRAILR2 TRICK2 TRICK2A TRICK2B TRICKB ZTNFR9 |
tumor necrosis factor receptor superfamily, member 10b | benzyloxycarbonyl-isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone inhibits the reaction [alpha-Tocopherol analog results in increased expression of TNFRSF10B protein] |
decreases reaction
/ increases expression |
protein |
20686688
|
| D024502 | 8795 |
TNFRSF10B
CD262 DR5 KILLER KILLER/DR5 TRAIL-R2 TRAILR2 TRICK2 TRICK2A TRICK2B TRICKB ZTNFR9 |
tumor necrosis factor receptor superfamily, member 10b | salubrinal inhibits the reaction [alpha-Tocopherol analog results in increased expression of TNFRSF10B protein] |
decreases reaction
/ increases expression |
protein |
20686688
|
| D024502 | 8795 |
TNFRSF10B
CD262 DR5 KILLER KILLER/DR5 TRAIL-R2 TRAILR2 TRICK2 TRICK2A TRICK2B TRICKB ZTNFR9 |
tumor necrosis factor receptor superfamily, member 10b | TNFRSF10B mRNA affects the reaction [alpha-Tocopherol analog results in decreased expression of BCL2 protein] |
affects reaction
/ decreases expression |
mRNA |
20686688
|
| D024502 | 7157 |
TP53
BCC7 LFS1 P53 TRP53 |
tumor protein p53 | alpha-Tocopherol inhibits the reaction [arsenite results in increased expression of TP53 mRNA] |
decreases reaction
/ increases expression |
mRNA |
12126965
|
| D024502 | 7157 |
TP53
BCC7 LFS1 P53 TRP53 |
tumor protein p53 | alpha-Tocopherol inhibits the reaction [arsenite results in increased expression of TP53 protein] |
decreases reaction
/ increases expression |
protein |
12126965
|
| D024502 | 7412 |
VCAM1
CD106 INCAM-100 |
vascular cell adhesion molecule 1 | alpha-Tocopherol inhibits the reaction [Hydrogen Peroxide results in increased expression of VCAM1 protein] |
decreases reaction
/ increases expression |
protein |
12566129
|
| D024502 | 7412 |
VCAM1
CD106 INCAM-100 |
vascular cell adhesion molecule 1 | alpha-Tocopherol inhibits the reaction [Vehicle Emissions results in increased expression of VCAM1 protein] |
decreases reaction
/ increases expression |
protein |
22313677
|
| D024502 | 7494 |
XBP1
TREB5 XBP-1 XBP2 |
X-box binding protein 1 | alpha-Tocopherol analog results in increased expression of XBP1 mRNA |
increases expression
|
mRNA |
20686688
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|
| #103780 | Alcohol dependence |
P08172
P14416 P31645 |
| #614373 | Amyotrophic lateral sclerosis 16, juvenile; als16 |
Q99720
|
| #602025 | Body mass index quantitative trait locus 9; bmiq9 |
P41968
|
| #300615 | Brunner syndrome |
P21397
|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #162800 | Cyclic neutropenia |
P08246
|
| #612522 | Diabetes mellitus, insulin-dependent, 22; iddm22 |
P51681
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #615363 | Estrogen resistance; estrr |
P03372
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #613659 | Gastric cancer |
P04626
|
| #137215 | Gastric cancer, hereditary diffuse; hdgc |
P04626
|
| #231095 | Ghosal hematodiaphyseal dysplasia; ghdd |
P24557
|
| #137800 | Glioma susceptibility 1; glm1 |
P04626
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #609423 | Human immunodeficiency virus type 1, susceptibility to |
P41597
P51681 |
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #603932 | Intervertebral disc disease; idd |
P14780
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #613688 | Long qt syndrome 2; lqt2 |
Q12809
|
| #211980 | Lung cancer |
P00533
P04626 |
| #608516 | Major depressive disorder; mdd |
P08172
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| %300852 | Mental retardation, x-linked 88; mrx88 |
P50052
|
| #613073 | Metaphyseal anadysplasia 2; mandp2 |
P14780
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #126200 | Multiple sclerosis, susceptibility to; ms |
P08575
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #159900 | Myoclonic dystonia |
P14416
|
| #202700 | Neutropenia, severe congenital, 1, autosomal dominant; scn1 |
P08246
|
| #601665 | Obesity |
P32245
|
| #164230 | Obsessive-compulsive disorder; ocd |
P31645
|
| #604715 | Orthostatic intolerance |
P23975
|
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 |
P00918
|
| #167000 | Ovarian cancer |
P04626
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #613135 | Parkinsonism-dystonia, infantile; pkdys |
Q01959
|
| #172700 | Pick disease of brain |
P10636
|
| #607276 | Resting heart rate, variation in |
P08588
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| #608971 | Severe combined immunodeficiency, autosomal recessive, t cell-negative, b cell-positive, nk cell-positive |
P08575
|
| #609620 | Short qt syndrome 1; sqt1 |
Q12809
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth |
P10828
|
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth |
P10828
|
| #145650 | Thyroid hormone resistance, selective pituitary; prth |
P10828
|
| #190300 | Tremor, hereditary essential, 1; etm1 |
P35462
|
| #610379 | West nile virus, susceptibility to |
P51681
|
| #112100 | Yt blood group antigen |
P22303
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00016 | Oral cancer |
P00533
(related)
P00533 (marker) |
| H00017 | Esophageal cancer |
P00533
(related)
P35354 (related) |
| H00018 | Gastric cancer |
P00533
(related)
P04626 (related) |
| H00022 | Bladder cancer |
P00533
(related)
P04626 (related) |
| H00028 | Choriocarcinoma |
P00533
(related)
P03956 (related) P04626 (related) |
| H00030 | Cervical cancer |
P00533
(related)
P04626 (related) |
| H00042 | Glioma |
P00533
(related)
P00533 (marker) |
| H00055 | Laryngeal cancer |
P00533
(related)
P00533 (marker) |
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) |
P00918
(related)
|
| H00436 | Osteopetrosis |
P00918
(related)
|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
|
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00026 | Endometrial Cancer |
P03372
(marker)
P04626 (related) Q92731 (marker) |
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P04150
(related)
|
| H00019 | Pancreatic cancer |
P04626
(related)
|
| H00027 | Ovarian cancer |
P04626
(related)
|
| H00031 | Breast cancer |
P04626
(related)
P04626 (marker) |
| H00046 | Cholangiocarcinoma |
P04626
(related)
P35354 (related) |
| H00093 | Combined immunodeficiencies (CIDs) |
P06239
(related)
|
| H00079 | Asthma |
P07550
(related)
|
| H00100 | Neutropenic disorders |
P08246
(related)
|
| H00091 | T-B+Severe combined immunodeficiencies (SCIDs) |
P08575
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00249 | Thyroid hormone resistance syndrome |
P10828
(related)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00025 | Penile cancer |
P14780
(related)
P35354 (related) |
| H00479 | Metaphyseal dysplasias |
P14780
(related)
|
| H00548 | Brunner syndrome |
P21397
(related)
|
| H01031 | Orthostatic intolerance (OI) |
P23975
(related)
|
| H00490 | Diaphyseal dysplasia with anemia (Ghosal) |
P24557
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
P50052
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00720 | Long QT syndrome |
Q12809
(related)
|
| H00725 | Short QT syndrome |
Q12809
(related)
|
| MeSH disease | OMIM | compound | disease name | evidence type |
reference
pmid |
|---|---|---|---|---|---|
| D015746 | D024502 | Abdominal Pain |
marker/mechanism
|
16260695
|
|
| D058186 | D024502 | Acute Kidney Injury |
therapeutic
|
8891671
19766176 |
|
| D000755 | D024502 | Anemia, Sickle Cell |
therapeutic
|
15997260
|
|
| D001247 | D024502 | Asthenia |
marker/mechanism
|
16260695
|
|
| C535393 | D024502 | Ataxia with vitamin E deficiency |
therapeutic
|
10896705
|
|
| D001284 | D024502 | Atrophy |
therapeutic
|
23633841
|
|
| D001836 | D024502 | Body Weight Changes |
therapeutic
|
23633841
|
|
| D001930 | D024502 | Brain Injuries |
therapeutic
|
14645467
19941068 |
|
| D002279 | D024502 | Carcinoma 256, Walker |
therapeutic
|
19781538
|
|
| D002318 | D024502 | Cardiovascular Diseases |
therapeutic
|
19769483
|
|
| D002471 | D024502 | Cell Transformation, Neoplastic |
therapeutic
|
21344382
|
|
| D002493 | D024502 | Central Nervous System Diseases |
marker/mechanism
|
18942769
|
|
| D003072 | D024502 | Cognition Disorders |
therapeutic
|
19464315
21447382 |
|
| D003556 | D024502 | Cystitis |
therapeutic
|
15232716
|
|
| D003924 | D024502 | Diabetes Mellitus, Type 2 |
marker/mechanism
|
16506275
|
|
| D056486 | D024502 | Drug-Induced Liver Injury |
therapeutic
|
3509882
|
|
| D064420 | D024502 | Drug-Related Side Effects and Adverse Reactions |
therapeutic
|
7616398
9093712 |
|
| D005334 | D024502 | Fever |
therapeutic
|
16844102
|
|
| D005355 | D024502 | Fibrosis |
therapeutic
|
16260695
|
|
| D005767 | D024502 | Gastrointestinal Diseases |
marker/mechanism
|
9199886
|
|
| D005923 | D024502 | Glomerulosclerosis, Focal Segmental |
therapeutic
|
7838258
|
|
| D006261 | D024502 | Headache |
marker/mechanism
|
16260695
|
|
| D006461 | D024502 | Hemolysis |
therapeutic
|
10704919
|
|
| D006949 | D024502 | Hyperlipidemias |
therapeutic
|
7838258
|
|
| D006965 | D024502 | Hyperplasia |
therapeutic
|
23633841
|
|
| D006973 | D024502 | Hypertension |
therapeutic
|
9880131
|
|
| D007511 | D024502 | Ischemia |
therapeutic
|
8891671
|
|
| D007674 | D024502 | Kidney Diseases |
therapeutic
|
18502357
|
|
| D008113 | D024502 | Liver Neoplasms |
therapeutic
|
7852184
|
|
| D008175 | D024502 | Lung Neoplasms |
therapeutic
|
16401635
|
|
| D008569 | D024502 | Memory Disorders |
therapeutic
|
15364477
|
|
| D009135 | D024502 | Muscular Diseases |
therapeutic
|
1566986
|
|
| D009203 | D024502 | Myocardial Infarction |
therapeutic
|
9055097
16757080 19595682 20979156 |
|
| D009325 | D024502 | Nausea |
marker/mechanism
|
16260695
|
|
| D009336 | D024502 | Necrosis |
therapeutic
|
19066852
|
|
| D009362 | D024502 | Neoplasm Metastasis |
therapeutic
|
19781538
|
|
| D009410 | D024502 | Nerve Degeneration |
therapeutic
|
1806894
|
|
| D009422 | D024502 | Nervous System Diseases |
therapeutic
|
11752462
15753152 16844102 |
|
| D009436 | D024502 | Neural Tube Defects |
therapeutic
|
12739027
|
|
| D010014 | D024502 | Osteolysis |
therapeutic
|
19781538
|
|
| D010049 | D024502 | Ovarian Diseases |
therapeutic
|
23633841
|
|
| D010146 | D024502 | Pain |
therapeutic
|
1566986
|
|
| D011041 | D024502 | Poisoning |
therapeutic
|
16614824
|
|
| D011230 | D024502 | Precancerous Conditions |
therapeutic
|
9093712
|
|
| D011507 | D024502 | Proteinuria |
therapeutic
|
7919151
9608545 14714169 |
|
| D011561 | D024502 | Pseudoxanthoma Elasticum |
therapeutic
|
17845175
|
|
| D011657 | D024502 | Pulmonary Eosinophilia |
therapeutic
|
14606601
|
|
| D011832 | D024502 | Radiation Injuries |
therapeutic
|
16260695
|
|
| D051437 | D024502 | Renal Insufficiency |
therapeutic
|
11700016
|
|
| D015427 | D024502 | Reperfusion Injury |
therapeutic
|
8891671
12910483 20609232 |
|
| D012174 | D024502 | Retinitis Pigmentosa |
therapeutic
|
16849425
|
|
| D012640 | D024502 | Seizures |
therapeutic
|
17543232
20602035 |
|
| D014029 | D024502 | Tobacco Use Disorder |
marker/mechanism
|
9269585
|
|
| D014591 | D024502 | Uterine Diseases |
therapeutic
|
23633841
|
|
| D014717 | D024502 | Vertigo |
marker/mechanism
|
16260695
|