| id | C00007681 |
|---|---|
| Name | alpha-Isosparteine |
| CAS RN | 446-95-7 |
| Standard InChI | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12?,13?,14-,15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2 |
| Phytochemical cluster | No. 3 |
|---|---|
| KCF-S cluster | No. 424 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL412873 CHEMBL44625 CHEMBL172633 CHEMBL1328708 CHEMBL1492771 CHEMBL1740920 CHEMBL1908847 CHEMBL2010478 |
| By LinkDB | C17418 |
|---|
| By CAS RN |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL44625 CHEMBL172633 CHEMBL1328708 |
CHEMBL663531
(1)
CHEMBL860702
(1)
CHEMBL1614110 (1) CHEMBL1741321 (1) CHEMBL1743272 (1) CHEMBL1909136 (2) |
1 / 0 |
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL44625 |
CHEMBL1909139
(2)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL44625 |
CHEMBL1909131
(2)
|
0 / 3 |
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL44625 |
CHEMBL1909190
(2)
|
2 / 2 |
| P08246 | Neutrophil elastase | S1A | CHEMBL44625 |
CHEMBL1909195
(2)
|
2 / 1 |
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL44625 |
CHEMBL1909215
(2)
|
0 / 0 |
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL44625 |
CHEMBL1909201
(2)
|
0 / 0 |
| P49146 | Neuropeptide Y receptor type 2 | Neuropeptide Y receptor | CHEMBL44625 |
CHEMBL1909176
(2)
|
0 / 0 |
| P29466 | Caspase-1 | C14 | CHEMBL44625 |
CHEMBL1909193
(2)
|
0 / 0 |
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL44625 |
CHEMBL1909198
(2)
|
0 / 0 |
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL44625 |
CHEMBL1909199
(2)
|
0 / 0 |
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL44625 |
CHEMBL1909197
(2)
|
2 / 2 |
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL1328708 |
CHEMBL1614544
(1)
|
11 / 10 |
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL44625 |
CHEMBL1909123
(2)
|
1 / 2 |
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL44625 |
CHEMBL1909092
(2)
|
0 / 1 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL44625 |
CHEMBL1909169
(2)
|
1 / 1 |
| P25021 | Histamine H2 receptor | Histamine receptor | CHEMBL44625 |
CHEMBL1909157
(2)
|
0 / 0 |
| P35367 | Histamine H1 receptor | Histamine receptor | CHEMBL44625 |
CHEMBL1909156
(2)
|
0 / 0 |
| Q01959 | Sodium-dependent dopamine transporter | Dopamine | CHEMBL44625 |
CHEMBL1909143
(2)
|
1 / 0 |
| P08912 | Muscarinic acetylcholine receptor M5 | Acetylcholine receptor | CHEMBL44625 |
CHEMBL1909174
(2)
|
0 / 0 |
| P18825 | Alpha-2C adrenergic receptor | Adrenergic receptor | CHEMBL44625 |
CHEMBL1909090
(2)
|
0 / 0 |
| P13945 | Beta-3 adrenergic receptor | Adrenergic receptor | CHEMBL44625 |
CHEMBL1909093
(2)
|
0 / 0 |
| P25024 | C-X-C chemokine receptor type 1 | CXC chemokine receptor | CHEMBL44625 |
CHEMBL1909127
(2)
|
0 / 0 |
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL44625 |
CHEMBL1909204
(2)
|
0 / 0 |
| Q08209 | Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform | Ser_Thr | CHEMBL44625 |
CHEMBL1909202
(2)
|
0 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL44625 CHEMBL1328708 |
CHEMBL1741325
(1)
CHEMBL1909135
(2)
|
0 / 1 |
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL44625 |
CHEMBL1909203
(2)
|
1 / 11 |
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL44625 |
CHEMBL1909140
(2)
|
2 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL44625 |
CHEMBL1909130
(2)
|
0 / 0 |
| P37288 | Vasopressin V1a receptor | Vasopressin and oxytocin receptor | CHEMBL44625 |
CHEMBL1909120
(2)
|
0 / 0 |
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL44625 |
CHEMBL1909181
(2)
|
0 / 0 |
| Q9Y271 | Cysteinyl leukotriene receptor 1 | Leukotriene receptor | CHEMBL44625 |
CHEMBL1909164
(2)
|
0 / 0 |
| P29274 | Adenosine receptor A2a | Adenosine receptor | CHEMBL44625 |
CHEMBL1909214
(2)
|
0 / 0 |
| P25929 | Neuropeptide Y receptor type 1 | Neuropeptide Y receptor | CHEMBL44625 |
CHEMBL1909175
(2)
|
0 / 0 |
| P50052 | Type-2 angiotensin II receptor | Angiotensin receptor | CHEMBL44625 |
CHEMBL1909096
(2)
|
1 / 1 |
| P17948 | Vascular endothelial growth factor receptor 1 | Vegfr | CHEMBL44625 |
CHEMBL1909118
(2)
|
0 / 0 |
| P41968 | Melanocortin receptor 3 | Melanocortin receptor | CHEMBL44625 |
CHEMBL1909166
(2)
|
1 / 0 |
| P11509 | Cytochrome P450 2A6 | Cytochrome P450 2A6 | CHEMBL44625 |
CHEMBL1909133
(2)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1328708 |
CHEMBL1738606
(1)
|
0 / 0 |
| P04035 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | Oxidoreductase | CHEMBL44625 |
CHEMBL1909158
(2)
|
0 / 0 |
| P08913 | Alpha-2A adrenergic receptor | Adrenergic receptor | CHEMBL44625 |
CHEMBL1909088
(2)
|
0 / 0 |
| P21917 | D(4) dopamine receptor | Dopamine receptor | CHEMBL44625 |
CHEMBL1909142
(2)
|
0 / 0 |
| P30988 | Calcitonin receptor | Calcitonin receptor | CHEMBL44625 |
CHEMBL1909101
(2)
|
0 / 0 |
| P35462 | D(3) dopamine receptor | Dopamine receptor | CHEMBL44625 |
CHEMBL1909141
(2)
|
1 / 0 |
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL44625 |
CHEMBL1909180
(2)
|
0 / 0 |
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL44625 |
CHEMBL1909146
(2)
|
0 / 1 |
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL44625 |
CHEMBL1909104
(2)
|
0 / 0 |
| P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL44625 |
CHEMBL1909144
(2)
|
0 / 0 |
| P30411 | B2 bradykinin receptor | Bradykinin receptor | CHEMBL44625 |
CHEMBL1909100
(2)
|
0 / 0 |
| P32245 | Melanocortin receptor 4 | Melanocortin receptor | CHEMBL44625 |
CHEMBL1909167
(2)
|
1 / 0 |
| P32238 | Cholecystokinin receptor type A | Cholecystokinin receptor | CHEMBL44625 |
CHEMBL1909129
(2)
|
0 / 0 |
| P08311 | Cathepsin G | S1A | CHEMBL44625 |
CHEMBL1909194
(2)
|
0 / 0 |
| Q99720 | Sigma non-opioid intracellular receptor 1 | Membrane receptor | CHEMBL44625 |
CHEMBL1909110
(2)
|
1 / 0 |
| P03956 | Interstitial collagenase | M10A | CHEMBL44625 |
CHEMBL1909196
(2)
|
0 / 1 |
| P32241 | Vasoactive intestinal polypeptide receptor 1 | Vasoactive intestinal peptide receptor | CHEMBL44625 |
CHEMBL1909119
(2)
|
0 / 0 |
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL44625 |
CHEMBL1909150
(2)
|
0 / 1 |
| P08172 | Muscarinic acetylcholine receptor M2 | Acetylcholine receptor | CHEMBL44625 |
CHEMBL1909171
(2)
|
2 / 0 |
| P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL44625 |
CHEMBL1909170
(2)
|
0 / 0 |
| P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL44625 |
CHEMBL1909122
(2)
|
0 / 0 |
| P31645 | Sodium-dependent serotonin transporter | Serotonin | CHEMBL44625 |
CHEMBL1909109
(2)
|
2 / 0 |
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL44625 |
CHEMBL1909205
(2)
|
5 / 10 |
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL44625 |
CHEMBL1909172
(2)
|
1 / 0 |
| P21452 | Substance-K receptor | Neurokinin receptor | CHEMBL44625 |
CHEMBL1909114
(2)
|
0 / 0 |
| P51679 | C-C chemokine receptor type 4 | CC chemokine receptor | CHEMBL44625 |
CHEMBL1909125
(2)
|
0 / 0 |
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL44625 |
CHEMBL1909126
(2)
|
3 / 0 |
| P50406 | 5-hydroxytryptamine receptor 6 | Serotonin receptor | CHEMBL44625 |
CHEMBL1909108
(2)
|
0 / 0 |
| P41597 | C-C chemokine receptor type 2 | CC chemokine receptor | CHEMBL44625 |
CHEMBL1909124
(2)
|
1 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL44625 |
CHEMBL1909200
(2)
|
0 / 0 |
| P08575 | Receptor-type tyrosine-protein phosphatase C | Enzyme | CHEMBL44625 |
CHEMBL1909207
(2)
|
2 / 1 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL44625 CHEMBL1328708 |
CHEMBL1741322
(1)
CHEMBL1909132
(2)
|
0 / 0 |
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL44625 |
CHEMBL1909186
(2)
|
0 / 0 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL44625 |
CHEMBL1909145
(2)
|
1 / 1 |
| P08588 | Beta-1 adrenergic receptor | Adrenergic receptor | CHEMBL44625 |
CHEMBL1909091
(2)
|
1 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL44625 |
CHEMBL1909212
(2)
|
1 / 0 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL44625 |
CHEMBL1909211
(2)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL44625 |
CHEMBL1909105
(2)
|
0 / 0 |
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL44625 |
CHEMBL1909182
(2)
|
0 / 0 |
| P08173 | Muscarinic acetylcholine receptor M4 | Acetylcholine receptor | CHEMBL44625 |
CHEMBL1909173
(2)
|
0 / 0 |
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL44625 |
CHEMBL1909113
(2)
|
0 / 0 |
| P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL44625 |
CHEMBL1909187
(2)
|
0 / 0 |
| P33032 | Melanocortin receptor 5 | Melanocortin receptor | CHEMBL44625 |
CHEMBL1909168
(2)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL44625 CHEMBL1328708 |
CHEMBL1741323
(1)
CHEMBL1909134
(2)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL44625 CHEMBL1328708 |
CHEMBL1741324
(1)
CHEMBL1909138
(2)
|
0 / 1 |
| P05181 | Cytochrome P450 2E1 | Cytochrome P450 2E1 | CHEMBL44625 |
CHEMBL1909137
(2)
|
0 / 0 |
| P23975 | Sodium-dependent noradrenaline transporter | Norepinephrine | CHEMBL44625 |
CHEMBL1909094
(2)
|
1 / 1 |
| P25100 | Alpha-1D adrenergic receptor | Adrenergic receptor | CHEMBL44625 |
CHEMBL1909087
(2)
|
0 / 0 |
| P30542 | Adenosine receptor A1 | Adenosine receptor | CHEMBL44625 |
CHEMBL1909213
(2)
|
0 / 0 |
| P18089 | Alpha-2B adrenergic receptor | Adrenergic receptor | CHEMBL44625 |
CHEMBL1909089
(2)
|
0 / 0 |
| P24557 | Thromboxane-A synthase | Cytochrome P450 5A1 | CHEMBL44625 |
CHEMBL1909116
(2)
|
1 / 1 |
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL44625 |
CHEMBL1909206
(2)
|
0 / 1 |
| P25025 | C-X-C chemokine receptor type 2 | CXC chemokine receptor | CHEMBL44625 |
CHEMBL1909128
(2)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL1492771 |
CHEMBL1614531
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1492771 |
CHEMBL1614531
(1)
|
1 / 3 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|
| #103780 | Alcohol dependence |
P08172
P14416 P31645 |
| #614373 | Amyotrophic lateral sclerosis 16, juvenile; als16 |
Q99720
|
| #602025 | Body mass index quantitative trait locus 9; bmiq9 |
P41968
|
| #300615 | Brunner syndrome |
P21397
|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #162800 | Cyclic neutropenia |
P08246
|
| #612522 | Diabetes mellitus, insulin-dependent, 22; iddm22 |
P51681
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #615363 | Estrogen resistance; estrr |
P03372
|
| #613659 | Gastric cancer |
P04626
|
| #137215 | Gastric cancer, hereditary diffuse; hdgc |
P04626
|
| #231095 | Ghosal hematodiaphyseal dysplasia; ghdd |
P24557
|
| #137800 | Glioma susceptibility 1; glm1 |
P04626
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #609423 | Human immunodeficiency virus type 1, susceptibility to |
P41597
P51681 |
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #603932 | Intervertebral disc disease; idd |
P14780
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #613688 | Long qt syndrome 2; lqt2 |
Q12809
|
| #211980 | Lung cancer |
P00533
P04626 |
| #608516 | Major depressive disorder; mdd |
P08172
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| %300852 | Mental retardation, x-linked 88; mrx88 |
P50052
|
| #613073 | Metaphyseal anadysplasia 2; mandp2 |
P14780
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #126200 | Multiple sclerosis, susceptibility to; ms |
P08575
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #159900 | Myoclonic dystonia |
P14416
|
| #202700 | Neutropenia, severe congenital, 1, autosomal dominant; scn1 |
P08246
|
| #601665 | Obesity |
P32245
|
| #164230 | Obsessive-compulsive disorder; ocd |
P31645
|
| #604715 | Orthostatic intolerance |
P23975
|
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 |
P00918
|
| #167000 | Ovarian cancer |
P04626
|
| #613135 | Parkinsonism-dystonia, infantile; pkdys |
Q01959
|
| #607276 | Resting heart rate, variation in |
P08588
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| #608971 | Severe combined immunodeficiency, autosomal recessive, t cell-negative, b cell-positive, nk cell-positive |
P08575
|
| #609620 | Short qt syndrome 1; sqt1 |
Q12809
|
| #190300 | Tremor, hereditary essential, 1; etm1 |
P35462
|
| #610379 | West nile virus, susceptibility to |
P51681
|
| #112100 | Yt blood group antigen |
P22303
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00016 | Oral cancer |
P00533
(related)
P00533 (marker) |
| H00017 | Esophageal cancer |
P00533
(related)
P35354 (related) |
| H00018 | Gastric cancer |
P00533
(related)
P04626 (related) |
| H00022 | Bladder cancer |
P00533
(related)
P04626 (related) |
| H00028 | Choriocarcinoma |
P00533
(related)
P03956 (related) P04626 (related) |
| H00030 | Cervical cancer |
P00533
(related)
P04626 (related) |
| H00042 | Glioma |
P00533
(related)
P00533 (marker) |
| H00055 | Laryngeal cancer |
P00533
(related)
P00533 (marker) |
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) |
P00918
(related)
|
| H00436 | Osteopetrosis |
P00918
(related)
|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
|
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00026 | Endometrial Cancer |
P03372
(marker)
P04626 (related) Q92731 (marker) |
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P04150
(related)
|
| H00019 | Pancreatic cancer |
P04626
(related)
|
| H00027 | Ovarian cancer |
P04626
(related)
|
| H00031 | Breast cancer |
P04626
(related)
P04626 (marker) |
| H00046 | Cholangiocarcinoma |
P04626
(related)
P35354 (related) |
| H00093 | Combined immunodeficiencies (CIDs) |
P06239
(related)
|
| H00079 | Asthma |
P07550
(related)
|
| H00100 | Neutropenic disorders |
P08246
(related)
|
| H00091 | T-B+Severe combined immunodeficiencies (SCIDs) |
P08575
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00025 | Penile cancer |
P14780
(related)
P35354 (related) |
| H00479 | Metaphyseal dysplasias |
P14780
(related)
|
| H00548 | Brunner syndrome |
P21397
(related)
|
| H01031 | Orthostatic intolerance (OI) |
P23975
(related)
|
| H00490 | Diaphyseal dysplasia with anemia (Ghosal) |
P24557
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
P50052
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00720 | Long QT syndrome |
Q12809
(related)
|
| H00725 | Short QT syndrome |
Q12809
(related)
|