| id | C00008246 |
|---|---|
| Name | Isoxanthohumol(Sophora) |
| CAS RN | 70872-29-6 |
| Standard InChI | InChI=1S/C21H22O5/c1-12(2)4-9-15-16(23)10-19(25-3)20-17(24)11-18(26-21(15)20)13-5-7-14(22)8-6-13/h4-8,10,18,22-23H,9,11H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O5/c1-12(2)4-9-15-16(23)10-19(25-3)20-17(24)11-18(26-21(15)20)13-5-7-14(22)8-6-13/h4-8,10,18,22-23H,9,11H2,1-3H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 28 |
| By standard InChI | CHEMBL492828 |
|---|---|
| By standard InChI Main Layer | CHEMBL492828 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sophora angustifolia | 3896 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O15530 | 3-phosphoinositide-dependent protein kinase 1 | Pdk1 | CHEMBL492828 |
CHEMBL2039412
(1)
|
0 / 0 |
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL492828 |
CHEMBL2039490
(1)
|
0 / 0 |
| Q04759 | Protein kinase C theta type | Delta | CHEMBL492828 |
CHEMBL2039491
(1)
|
0 / 1 |
| P56817 | Beta-secretase 1 | A1A | CHEMBL492828 |
CHEMBL946249
(2)
|
0 / 0 |