| id | C00008274 |
|---|---|
| Name | Sophoraflavanone A / 8-Geranylnaringenin |
| CAS RN | 87893-18-3 |
| Standard InChI | InChI=1S/C25H28O5/c1-15(2)5-4-6-16(3)7-12-19-20(27)13-21(28)24-22(29)14-23(30-25(19)24)17-8-10-18(26)11-9-17/h5,7-11,13,23,26-28H,4,6,12,14H2,1-3H3/b16-7+ |
| Standard InChI (Main Layer) | InChI=1S/C25H28O5/c1-15(2)5-4-6-16(3)7-12-19-20(27)13-21(28)24-22(29)14-23(30-25(19)24)17-8-10-18(26)11-9-17/h5,7-11,13,23,26-28H,4,6,12,14H2,1-3H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 19 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL490697 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Angelica keiskei | 357850 | Apiaceae | asterids | Viridiplantae |
| Dalbergia candenatensis | 53862 | Fabaceae | rosids | Viridiplantae |
| Sophora tomentosa | 256637 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL490697 |
CHEMBL1694230
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #614490 | Blood group, junior system; jr |
Q9UNQ0
|
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 |
Q9UNQ0
|