| id | C00008301 |
|---|---|
| Name | Persiconin |
| CAS RN | 28978-03-2 |
| Standard InChI | InChI=1S/C23H26O11/c1-30-11-6-16-19(13(26)8-15(32-16)10-3-4-14(31-2)12(25)5-10)17(7-11)33-23-22(29)21(28)20(27)18(9-24)34-23/h3-7,15,18,20-25,27-29H,8-9H2,1-2H3/t15?,18?,20-,21+,22?,23-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H26O11/c1-30-11-6-16-19(13(26)8-15(32-16)10-3-4-14(31-2)12(25)5-10)17(7-11)33-23-22(29)21(28)20(27)18(9-24)34-23/h3-7,15,18,20-25,27-29H,8-9H2,1-2H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 12 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Prunus persica | 3760 | Rosaceae | rosids | Viridiplantae |
| Prunus spp. | 3754 | Rosaceae | rosids | Viridiplantae |