| id | C00008357 |
|---|---|
| Name | 5,3',4'-Trihydroxy-7-methoxy-8-C-prenylflavanone |
| CAS RN | 72944-03-7 |
| Standard InChI | InChI=1S/C21H22O6/c1-11(2)4-6-13-19(26-3)10-17(25)20-16(24)9-18(27-21(13)20)12-5-7-14(22)15(23)8-12/h4-5,7-8,10,18,22-23,25H,6,9H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O6/c1-11(2)4-6-13-19(26-3)10-17(25)20-16(24)9-18(27-21(13)20)12-5-7-14(22)15(23)8-12/h4-5,7-8,10,18,22-23,25H,6,9H2,1-3H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 28 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Flourensia heterolepis | 191157 | Asteraceae | asterids | Viridiplantae |