| id | C00008457 |
|---|---|
| Name | Sigmoidin D |
| CAS RN | 106533-44-2 |
| Standard InChI | InChI=1S/C20H20O7/c1-20(2)17(25)5-10-3-9(4-14(24)19(10)27-20)15-8-13(23)18-12(22)6-11(21)7-16(18)26-15/h3-4,6-7,15,17,21-22,24-25H,5,8H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O7/c1-20(2)17(25)5-10-3-9(4-14(24)19(10)27-20)15-8-13(23)18-12(22)6-11(21)7-16(18)26-15/h3-4,6-7,15,17,21-22,24-25H,5,8H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 740 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL516331 |
| By LinkDB |
|---|
| By CAS RN | C051738 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Erythrina abyssinica | 1237573 | Fabaceae | rosids | Viridiplantae |
| Erythrina sigmoidea | 3841 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL516331 |
CHEMBL995832
(1)
|
0 / 0 |