| id | C00008497 |
|---|---|
| Name | Kenusanone I |
| CAS RN | 151782-74-0 |
| Standard InChI | InChI=1S/C21H22O6/c1-11(2)4-6-14-18(26-3)9-16(24)20-17(25)10-19(27-21(14)20)13-7-5-12(22)8-15(13)23/h4-5,7-9,19,22-24H,6,10H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O6/c1-11(2)4-6-14-18(26-3)9-16(24)20-17(25)10-19(27-21(14)20)13-7-5-12(22)8-15(13)23/h4-5,7-9,19,22-24H,6,10H2,1-3H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 28 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Echinosophora koreensis | 228658 | Fabaceae | rosids | Viridiplantae |
| Sophora flavescens | 49840 | Fabaceae | rosids | Viridiplantae |