| id | C00008651 |
|---|---|
| Name | Kushenol N |
| CAS RN | 102490-65-3 |
| Standard InChI | InChI=1S/C26H30O7/c1-13(2)6-7-15(14(3)4)10-18-20(29)12-21(32-5)22-23(30)24(31)26(33-25(18)22)17-9-8-16(27)11-19(17)28/h6,8-9,11-12,15,24,26-29,31H,3,7,10H2,1-2,4-5H3/t15?,24-,26-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H30O7/c1-13(2)6-7-15(14(3)4)10-18-20(29)12-21(32-5)22-23(30)24(31)26(33-25(18)22)17-9-8-16(27)11-19(17)28/h6,8-9,11-12,15,24,26-29,31H,3,7,10H2,1-2,4-5H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 19 |
| By standard InChI | CHEMBL243147 |
|---|---|
| By standard InChI Main Layer | CHEMBL243147 CHEMBL480281 CHEMBL1972376 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sophora flavescens | 49840 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL243147 |
CHEMBL892510
(1)
|
1 / 1 |
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL243147 |
CHEMBL892511
(1)
|
1 / 1 |