| id | C00008822 |
|---|---|
| Name | Fisetinidol |
| CAS RN | 490-49-3 |
| Standard InChI | InChI=1S/C15H14O5/c16-10-3-1-8-5-13(19)15(20-14(8)7-10)9-2-4-11(17)12(18)6-9/h1-4,6-7,13,15-19H,5H2/t13-,15+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H14O5/c16-10-3-1-8-5-13(19)15(20-14(8)7-10)9-2-4-11(17)12(18)6-9/h1-4,6-7,13,15-19H,5H2 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 52 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1367159 |
| By LinkDB | C09735 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 4 |
| Magnoliophyta | 2 |
| family name | count |
|---|---|
| Fabaceae | 4 |
| Myristicaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acacia mearnsii | 139012 | Fabaceae | rosids | Viridiplantae |
| Acacia spp. | 3808 | Fabaceae | rosids | Viridiplantae |
| Colophospermum mopane | 162715 | Fabaceae | rosids | Viridiplantae |
| Peltophorum africanum | 321567 | Fabaceae | rosids | Viridiplantae |
| Virola elongata | 224865 | Myristicaceae | Magnoliophyta | Viridiplantae |
| Virola minutifolia | 224865 | Myristicaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O15296 | Arachidonate 15-lipoxygenase B | Enzyme | CHEMBL1367159 |
CHEMBL1613800
(1)
|
0 / 0 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1367159 |
CHEMBL1614458
(1)
|
0 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL1367159 |
CHEMBL1613808
(1)
|
0 / 0 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1367159 |
CHEMBL1613910
(1)
|
3 / 3 |
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL1367159 |
CHEMBL1614240
(1)
|
0 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1367159 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1367159 |
CHEMBL1614211
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1367159 |
CHEMBL1614421
(1)
|
4 / 3 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1367159 |
CHEMBL1794536
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1367159 |
CHEMBL1613914
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency |
Q99714
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #300705 | Mental retardation, x-linked 17; mrx17 |
Q99714
|
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 |
Q99714
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
Q99714
(related)
|
| H00658 | Syndromic X-linked mental retardation |
Q99714
(related)
|
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency |
Q99714
(related)
|