| id | C00009058 |
|---|---|
| Name | Afzelechin-(4alpha->8)-catechin |
| CAS RN | 101339-38-2 |
| Standard InChI | InChI=1S/C30H26O11/c31-14-4-1-12(2-5-14)29-27(39)26(24-20(36)8-15(32)9-23(24)40-29)25-21(37)11-18(34)16-10-22(38)28(41-30(16)25)13-3-6-17(33)19(35)7-13/h1-9,11,22,26-29,31-39H,10H2/t22-,26-,27-,28+,29+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H26O11/c31-14-4-1-12(2-5-14)29-27(39)26(24-20(36)8-15(32)9-23(24)40-29)25-21(37)11-18(34)16-10-22(38)28(41-30(16)25)13-3-6-17(33)19(35)7-13/h1-9,11,22,26-29,31-39H,10H2 |
| Phytochemical cluster | No. 19 |
|---|---|
| KCF-S cluster | No. 16 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Rhizophoraceae | 1 |
| Rosaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Kandelia candel | 61147 | Rhizophoraceae | rosids | Viridiplantae |
| Potentilla viscosa | 23204 | Rosaceae | rosids | Viridiplantae |