| id | C00009092 |
|---|---|
| Name | [Catechin-(4alpha->8)]2-epicatechin |
| CAS RN | 97233-64-2 |
| Standard InChI | InChI=1S/C45H38O18/c46-18-10-27(54)33-32(11-18)61-42(16-2-5-21(48)25(52)8-16)39(59)37(33)35-29(56)14-30(57)36-38(40(60)43(63-45(35)36)17-3-6-22(49)26(53)9-17)34-28(55)13-23(50)19-12-31(58)41(62-44(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,31,37-43,46-60H,12H2/t31-,37+,38-,39+,40+,41-,42-,43-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C45H38O18/c46-18-10-27(54)33-32(11-18)61-42(16-2-5-21(48)25(52)8-16)39(59)37(33)35-29(56)14-30(57)36-38(40(60)43(63-45(35)36)17-3-6-22(49)26(53)9-17)34-28(55)13-23(50)19-12-31(58)41(62-44(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,31,37-43,46-60H,12H2 |
| Phytochemical cluster | No. 19 |
|---|---|
| KCF-S cluster | No. 29 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL290632 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Cupressaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cryptomeria japonica | 3369 | Cupressaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL290632 |
CHEMBL1066259
(1)
|
2 / 2 |
| P08253 | 72 kDa type IV collagenase | M10A | CHEMBL290632 |
CHEMBL1066258
(1)
|
1 / 3 |
| Q05513 | Protein kinase C zeta type | Iota | CHEMBL290632 |
CHEMBL769344
(1)
|
0 / 0 |
| Q04759 | Protein kinase C theta type | Delta | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
0 / 1 |
| Q02156 | Protein kinase C epsilon type | Eta | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
0 / 0 |
| O94806 | Serine/threonine-protein kinase D3 | Pkd | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
0 / 0 |
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
0 / 0 |
| Q05655 | Protein kinase C delta type | Delta | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
0 / 0 |
| P05129 | Protein kinase C gamma type | Alpha | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
1 / 1 |
| P05771 | Protein kinase C beta type | Alpha | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
0 / 0 |
| P24723 | Protein kinase C eta type | Eta | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
1 / 0 |
| P41743 | Protein kinase C iota type | Iota | CHEMBL290632 |
CHEMBL769344
(1)
|
0 / 0 |
| Q15139 | Serine/threonine-protein kinase D1 | Pkd | CHEMBL290632 |
CHEMBL769344
(1)
CHEMBL768504
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #603932 | Intervertebral disc disease; idd |
P14780
|
| #613073 | Metaphyseal anadysplasia 2; mandp2 |
P14780
|
| #259600 | Multicentric osteolysis, nodulosis, and arthropathy; mona |
P08253
|
| #605361 | Spinocerebellar ataxia 14; sca14 |
P05129
|
| #601367 | Stroke, ischemic |
P24723
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00063 | Spinocerebellar ataxia (SCA) |
P05129
(related)
|
| H00025 | Penile cancer |
P08253
(related)
P14780 (related) |
| H00028 | Choriocarcinoma |
P08253
(related)
|
| H00472 | Torg-Winchester syndrome |
P08253
(related)
|
| H00479 | Metaphyseal dysplasias |
P14780
(related)
|
| H00408 | Type I diabetes mellitus |
Q04759
(related)
|