| id | C00009132 |
|---|---|
| Name | Guibourtinidol-(4alpha->6')-fisetinidol |
| CAS RN | 127612-88-8 |
| Standard InChI | InChI=1S/C30H26O9/c31-16-4-1-14(2-5-16)29-28(37)27(19-8-7-18(33)11-26(19)39-29)20-12-22(34)23(35)13-21(20)30-24(36)9-15-3-6-17(32)10-25(15)38-30/h1-8,10-13,24,27-37H,9H2/t24-,27-,28-,29+,30+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H26O9/c31-16-4-1-14(2-5-16)29-28(37)27(19-8-7-18(33)11-26(19)39-29)20-12-22(34)23(35)13-21(20)30-24(36)9-15-3-6-17(32)10-25(15)38-30/h1-8,10-13,24,27-37H,9H2 |
| Phytochemical cluster | No. 19 |
|---|---|
| KCF-S cluster | No. 16 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Colophospermum mopane | 162715 | Fabaceae | rosids | Viridiplantae |