| id | C00009452 |
|---|---|
| Name | Isoprunetin / 5-O-Methylgenistein |
| CAS RN | 4569-98-6 |
| Standard InChI | InChI=1S/C16H12O5/c1-20-13-6-11(18)7-14-15(13)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H12O5/c1-20-13-6-11(18)7-14-15(13)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL1479463 |
|---|---|
| By standard InChI Main Layer | CHEMBL1479463 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06746 | DNA polymerase beta | Enzyme | CHEMBL1479463 |
CHEMBL1614079
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1479463 |
CHEMBL2114843
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1479463 |
CHEMBL2114931
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1479463 |
CHEMBL1738588
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1479463 |
CHEMBL1794483
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1479463 |
CHEMBL1613914
(1)
|
0 / 0 |