| id | C00009640 |
|---|---|
| Name | Homoedudiol / Sophorapterocarpan A / 3,9-Dihydroxy-8-prenylpterocarpan |
| CAS RN | 77369-92-7 |
| Standard InChI | InChI=1S/C20H20O4/c1-11(2)3-4-12-7-15-16-10-23-18-8-13(21)5-6-14(18)20(16)24-19(15)9-17(12)22/h3,5-9,16,20-22H,4,10H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O4/c1-11(2)3-4-12-7-15-16-10-23-18-8-13(21)5-6-14(18)20(16)24-19(15)9-17(12)22/h3,5-9,16,20-22H,4,10H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 188 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1088321 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Calopogonium mucunoides | 132433 | Fabaceae | rosids | Viridiplantae |
| Erythrina poeppigiana | 3841 | Fabaceae | rosids | Viridiplantae |
| Sophora franchetiana | 3896 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL1088321 |
CHEMBL1101504
(1)
|
0 / 0 |