| id | C00009880 |
|---|---|
| Name | Semilicoisoflavone B |
| CAS RN | 129280-33-7 |
| Standard InChI | InChI=1S/C20H16O6/c1-20(2)4-3-10-5-11(6-15(23)19(10)26-20)13-9-25-16-8-12(21)7-14(22)17(16)18(13)24/h3-9,21-23H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H16O6/c1-20(2)4-3-10-5-11(6-15(23)19(10)26-20)13-9-25-16-8-12(21)7-14(22)17(16)18(13)24/h3-9,21-23H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 24 |
| By standard InChI | CHEMBL1864439 |
|---|---|
| By standard InChI Main Layer | CHEMBL1864439 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycyrrhiza aspera | 74709 | Fabaceae | rosids | Viridiplantae |
| Glycyrrhiza uralensis | 74613 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL1864439 |
CHEMBL2114843
(1)
|
0 / 0 |